dexamethasone acefurate

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = [(8S,9R,10S,11S,13S,14S,16R,17R)-17-(2-Acetyloxyacetyl)-9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] furan-2-carboxylate

| image = Dexamethasone acefurate.svg

| width =

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref =

| CAS_number = 83880-70-0

| CAS_supplemental =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = W4N6E1T46B

| class = Corticosteroid; Glucocorticoid

| ATC_prefix =

| ATC_suffix =

| ATC_supplemental =

| PubChem = 656777

| IUPHAR_ligand =

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID_Ref =

| ChemSpiderID =

| KEGG =

| ChEBI =

| ChEMBL =

| C=29|H=33|F=1|O=8

| SMILES = C[C@@H]1C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@@]4([C@]3([C@H](C[C@@]2([C@]1(C(=O)COC(=O)C)OC(=O)C5=CC=CO5)C)O)F)C

| StdInChI_Ref =

| StdInChI = 1S/C29H33FO8/c1-16-12-21-20-8-7-18-13-19(32)9-10-26(18,3)28(20,30)23(33)14-27(21,4)29(16,24(34)15-37-17(2)31)38-25(35)22-6-5-11-36-22/h5-6,9-11,13,16,20-21,23,33H,7-8,12,14-15H2,1-4H3/t16-,20+,21+,23+,26+,27+,28+,29+/m1/s1

| StdInChIKey_Ref =

| StdInChIKey = DDIWRLSEGOVQQD-BJRLRHTOSA-N

| synonyms =

}}

Dexamethasone acefurate is a synthetic glucocorticoid corticosteroid and a corticosteroid ester.{{cite book | vauthors = Morton IK, Hall JM | chapter = Dexamethasone acefurate | chapter-url = https://books.google.com/books?id=tsjrCAAAQBAJ&dq=Dexamethasone+acefurate&pg=PA95 |title=Concise Dictionary of Pharmacological Agents : Properties and Synonyms |date=1999 |publisher=Springer Netherlands |location=Dordrecht |isbn=9789401144391 | pages = 95 }}