dexamethasone isonicotinate

{{Short description|Chemical compound}}

{{Infobox drug

| drug_name =

| image = Dexamethasone isonicotinate.png

| width = 250px

| caption = Skeletal formula of dexamethasone isonicotinate

| image2 = Dexamethasone isonicotinate 3D ball.png

| width2 = 250px

| caption2 = Ball-and-stick model of the dexamethasone isonicotinate molecule

| pronounce =

| tradename = Auxiloson, Auxilson, Auxilsone, Voren

| Drugs.com =

| MedlinePlus =

| licence_CA =

| licence_EU =

| DailyMedID =

| licence_US =

| pregnancy_AU =

| pregnancy_category =

| dependency_liability =

| addiction_liability =

| routes_of_administration =

| class =

| ATC_prefix =

| ATC_suffix =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action =

| excretion =

| CAS_number = 2265-64-7

| CAS_supplemental =

| PubChem = 16752

| IUPHAR_ligand =

| DrugBank = DB11487

| ChemSpiderID = 15881

| UNII = 8LGC0BOA71

| KEGG = D07797

| ChEBI = 177639

| ChEMBL = 3186453

| NIAID_ChemDB =

| PDB_ligand =

| synonyms = Dexamethasone 21-isonicotinate; Dexamethasone 21-(4-Pyridinecarboxylate); HE-111; 9α-Fluoro-11β,17α-dihydroxy-16α-methyl-3,20-dioxopregna-1,4-dien-21-yl isonicotinate; 9α-Fluoro-11β,17α,21-trihydroxy-16α-methylpregna-1,4-diene-3,20-dione 21-(4-pyridinecarboxylate)

| IUPAC_name = 2-[(1R,2R,3aS,3bS,9aS,9bR,10S,11aS)-9b-fluoro-1,10-dihydroxy-2,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,7,9a,9b,10,11,11a-dodecahydro-1H-cyclopenta[a]phenanthren-1-yl]-2-oxoethyl pyridine-4-carboxylate

| C=28 | H=32 | F=1 | N=1 | O=6

| SMILES = C[C@@H]1C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@@]4([C@]3([C@H](C[C@@]2([C@]1(C(=O)COC(=O)C5=CC=NC=C5)O)C)O)F)C

| StdInChI = 1S/C28H32FNO6/c1-16-12-21-20-5-4-18-13-19(31)6-9-25(18,2)27(20,29)22(32)14-26(21,3)28(16,35)23(33)15-36-24(34)17-7-10-30-11-8-17/h6-11,13,16,20-22,32,35H,4-5,12,14-15H2,1-3H3/t16-,20+,21+,22+,25+,26+,27+,28+/m1/s1

| StdInChIKey = BQTXJHAJMDGOFI-NJLPOHDGSA-N

}}

Dexamethasone isonicotinate is an anti-inflammatory, anti-allergic glucocorticoid that can be administered orally, by inhalation, locally, and parenterally.{{cite book | vauthors = Elks J | date = 14 November 2014 | title = The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies | publisher = Springer | pages = 367– | isbn = 978-1-4757-2085-3 | url = https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA367}}{{cite book | editor = Swiss Pharmaceutical Society | author = Swiss Pharmaceutical Society | date = 2000 | title = Index Nominum 2000: International Drug Directory | publisher = Taylor & Francis | pages = 310– | isbn = 978-3-88763-075-1 | url = https://books.google.com/books?id=5GpcTQD_L2oC&pg=PA310}}{{Additional citation needed|date=October 2021}} It may cause salt and water retention.{{Citation needed|date=October 2021}}