dexbudesonide

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = (4aR,4bS,5S,6aS,6bS,8R,9aR,10aS,10bS)-6b-Glycoloyl-5-hydroxy-4a,6a-dimethyl-8-propyl-4a,4b,5,6,6a,6b,9a,10,10a,10b,11,12-dodecahydro-2H-naphtho[2',1':4,5]indeno[1,2-d][1,3]dioxol-2-one

| image = Dexbudesonide.svg

| width = 250px

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref =

| CAS_number = 51372-29-3

| CAS_supplemental =

| class = Corticosteroid; Glucocorticoid

| ATC_prefix =

| ATC_suffix =

| ATC_supplemental =

| PubChem = 40000

| IUPHAR_ligand =

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID_Ref =

| ChemSpiderID = 36566

| UNII = 2HI1006KPH

| KEGG =

| ChEBI =

| ChEMBL =

| C=25 | H=34 | O=6

| SMILES = CCC[C@@H]1O[C@@H]2C[C@H]3[C@@H]4CCC5=CC(=O)C=C[C@@]5([C@H]4[C@H](C[C@@]3([C@@]2(O1)C(=O)CO)C)O)C

| StdInChI_Ref =

| StdInChI = 1S/C25H34O6/c1-4-5-21-30-20-11-17-16-7-6-14-10-15(27)8-9-23(14,2)22(16)18(28)12-24(17,3)25(20,31-21)19(29)13-26/h8-10,16-18,20-22,26,28H,4-7,11-13H2,1-3H3/t16-,17-,18-,20+,21+,22+,23-,24-,25+/m0/s1

| StdInChIKey_Ref =

| StdInChIKey = VOVIALXJUBGFJZ-VXKMTNQYSA-N

| synonyms = Budesonide 22R-epimer; 11β,21-Dihydroxy-16α(R),17α-(butylidenebis(oxy))pregna-1,4-diene-3,20-dione

}}

Dexbudesonide is a synthetic glucocorticoid corticosteroid which was never marketed.{{cite book | title = The use of stems in the selection of International Nonproprietary Names (INN) for pharmaceutical substances | url = https://www.who.int/medicines/services/inn/StemBook_2013_Final.pdf | date = 2013 | publisher = World Health Organization }}{{cite book| vauthors = Negwer M, Scharnow HG |title=Organic-chemical drugs and their synonyms: (an international survey)|url=https://books.google.com/books?id=1nBqAAAAMAAJ|year=2001|publisher=Wiley-VCH|isbn=978-3-527-30247-5|page=3560}}{{cite book| vauthors = Wouters J, Quéré L |title=Pharmaceutical Salts and Co-crystals|url=https://books.google.com/books?id=3HIoDwAAQBAJ&pg=PA309|date=4 November 2011|publisher=Royal Society of Chemistry|isbn=978-1-84973-350-2|pages=309–}} It is the 22R-epimer of budesonide.{{cite web | title = (22R)-Budesonide | url = https://www.trc-canada.com/product-detail/?B689500 | work = Toronto Research Chemicals }}