dexchlorpheniramine

{{Short description|Chemical compound}}

{{Drugbox

| verifiedrevid = 443584459

| IUPAC_name = (3S)-3-(4-chlorophenyl)-N,N-dimethyl-3-pyridin-3-ylpropan-1-amine

| image = Dexchlorpheniramine.svg

| image_class = skin-invert-image

| width = 200px

| drug_name = Dexchlorpheniramine

| tradename = Chlor-trimeton, Polaramine

| Drugs.com = {{drugs.com|monograph|chlorpheniramine-maleate-tannate-dexchlorpheniramine-maleate}}

| MedlinePlus = a682543

| pregnancy_category =

| legal_AU = S3

| routes_of_administration = Oral, Intravenous

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| IUPHAR_ligand = 1210

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 25523-97-1

| ATC_prefix = R06

| ATC_suffix = AB02

| PubChem = 33036

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB13679

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 30576

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 3Q9Q0B929N

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D07803

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 4464

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 1201353

| C=16 | H=19 | Cl=1 | N=2

| smiles = Clc1ccc(cc1)[C@@H](c2ncccc2)CCN(C)C

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C16H19ClN2/c1-19(2)12-10-15(16-5-3-4-11-18-16)13-6-8-14(17)9-7-13/h3-9,11,15H,10,12H2,1-2H3/t15-/m0/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = SOYKEARSMXGVTM-HNNXBMFYSA-N

}}

Dexchlorpheniramine (trade name Polaramine) is an antihistamine with anticholinergic properties used to treat allergic conditions such as hay fever or urticaria.{{cite journal | vauthors = Theunissen EL, Vermeeren A, Ramaekers JG | title = Repeated-dose effects of mequitazine, cetirizine and dexchlorpheniramine on driving and psychomotor performance | journal = British Journal of Clinical Pharmacology | volume = 61 | issue = 1 | pages = 79–86 | date = January 2006 | pmid = 16390354 | pmc = 1884990 | doi = 10.1111/j.1365-2125.2005.02524.x }}{{cite journal | vauthors = Ortíz San Román L, Sanavia Morán E, Campos Domínguez M, Peinador García MM | title = [Anticholinergic syndrome due to dexchlorpheniramine as a cause of urinary retention] | journal = Anales de Pediatria | volume = 79 | issue = 6 | pages = 400–401 | date = December 2013 | pmid = 23680058 | doi = 10.1016/j.anpedi.2013.02.014 }} It is the pharmacologically active dextrorotatory isomer of chlorpheniramine.

It came into medical use in 1959 and was patented in 1962.{{cite book | vauthors = Fischer J, Ganellin CR |title=Analogue-based Drug Discovery |date=2006 |publisher=John Wiley & Sons |isbn=9783527607495 |page=547 |url=https://books.google.com/books?id=FjKfqkaKkAAC&pg=PA547 |language=en}}