dexclamol

{{Short description|Antipsychotic compound}}

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{Infobox drug

| drug_name = Dexclamol

| image = Dexclamol.svg

| width =

| caption =

| pronounce =

| tradename =

| Drugs.com =

| MedlinePlus =

| licence_CA =

| licence_EU =

| DailyMedID =

| licence_US =

| pregnancy_AU =

| pregnancy_category =

| dependency_liability =

| addiction_liability =

| routes_of_administration =

| class =

| ATC_prefix =

| ATC_suffix =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action =

| excretion =

| CAS_number = 52340-25-7

| CAS_supplemental = HCl: 52389-27-2

| PubChem = 91267

| IUPHAR_ligand =

| DrugBank =

| ChemSpiderID = 16736937

| UNII = IGL2M625XH

| KEGG =

| ChEBI =

| ChEMBL = 320656

| NIAID_ChemDB =

| PDB_ligand =

| synonyms = AY 24169

| IUPAC_name = (1R,6R,8R)-6-propan-2-yl-3-azapentacyclo[11.8.1.03,8.09,22.016,21]docosa-9,11,13(22),16,18,20-hexaen-6-ol

| C = 24

| H = 29

| N = 1

| O = 1

| SMILES = CC(C)[C@]1(CCN2C[C@@H]3C4=CC=CC=C4CCC5=C3C(=CC=C5)[C@H]2C1)O

| StdInChI = 1S/C24H29NO/c1-16(2)24(26)12-13-25-15-21-19-8-4-3-6-17(19)10-11-18-7-5-9-20(23(18)21)22(25)14-24/h3-9,16,21-22,26H,10-15H2,1-2H3/t21-,22-,24-/m1/s1

| StdInChIKey = UPMOVJBGNREKJV-CQOQZXRMSA-N

}}

Dexclamol (AY 24169) was an investigational new drug developed by McKenna and Harrison, Ltd. that was evaluated as a antipsychotic.{{cite journal | vauthors = Humber LG, Bruderlein FT, Voith K | title = Neuroleptic agents of the benzocycloheptapyridoisoquinoline series. A hypothesis on their mode of interaction with the central dopamine receptor | journal = Molecular Pharmacology | volume = 11 | issue = 6 | pages = 833–840 | date = November 1975 | pmid = 1239657 }}{{cite book | veditors = Elks J, Ganellin CR | title = Dictionary of Drugs | date = 1990 | doi = 10.1007/978-1-4757-2085-3 | publisher = Springer US | url = http://link.springer.com/10.1007/978-1-4757-2085-3 | isbn = 978-1-4757-2087-7 }}{{cite journal | vauthors = Castañer J, Paton DM | title = Dexclamol hydrochloride | journal = Drugs of the Future | volume = 1 | issue = 8 | pages = 366 | date = 1976 | doi = 10.1358/dof.1976.001.08.1002521 }}{{cite patent | title = Benzocycloheptaisoquinoline derivatives | number = 3657250 | country = US | url = https://patents.google.com/patent/US3657250A/en?oq=US3657250 | inventor = Bruderlein FT, Humber LG | assign = Ayerst Mckenna and Harrison Inc. }} It acts as a dopamine receptor antagonist.