dexetimide
{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields = changed
| verifiedrevid = 460779595
| IUPAC_name = 3-(1-benzyl-4-piperidyl)-3-phenylpiperidine-2,6-dione
| image = Dexetimide.svg
| image_class = skin-invert-image
| tradename =
| Drugs.com = {{drugs.com|international|dexetimide}}
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_BR = C1
| legal_BR_comment = {{Cite web |author=Anvisa |author-link=Brazilian Health Regulatory Agency |date=2023-03-31 |title=RDC Nº 784 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial |trans-title=Collegiate Board Resolution No. 784 - Lists of Narcotic, Psychotropic, Precursor, and Other Substances under Special Control|url=https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |url-status=live |archive-url=https://web.archive.org/web/20230803143925/https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |archive-date=2023-08-03 |access-date=2023-08-16 |publisher=Diário Oficial da União |language=pt-BR |publication-date=2023-04-04}}
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|changed|??}}
| CAS_number = 21888-98-2
| ATC_prefix = N04
| ATC_suffix = AA08
| PubChem = 30843
| IUPHAR_ligand = 354
| DrugBank_Ref = {{drugbankcite|changed|drugbank}}
| DrugBank = DB08997
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 28615
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 43477QYX3D
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D03711
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 1908364
| C=23 | H=26 | N=2 | O=2
| smiles = O=C2NC(=O)CCC2(c1ccccc1)C4CCN(Cc3ccccc3)CC4
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C23H26N2O2/c26-21-11-14-23(22(27)24-21,19-9-5-2-6-10-19)20-12-15-25(16-13-20)17-18-7-3-1-4-8-18/h1-10,20H,11-17H2,(H,24,26,27)/t23-/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = LQQIVYSCPWCSSD-HSZRJFAPSA-N
}}
Dexetimide (brand name Tremblex) is a piperidine anticholinergic. It is a muscarinic antagonist that is used to treat drug induced parkinsonism. Dexetimide was discovered at Janssen Pharmaceutica in 1968.{{cite journal | vauthors = Dom R, Van Lommel R, Baro F | title = A quantitative study of neuroleptic-induced extrapyramidal symptoms and their response to dexetimide, a potent and long-acting antiparkinsonian agent | journal = Acta Psychiatrica Scandinavica | volume = 47 | issue = 4 | pages = 399–410 | year = 1971 | pmid = 4947805 | doi = 10.1111/j.1600-0447.1971.tb03697.x | s2cid = 10591790 }}{{cite journal | vauthors = Huygens H, Vereecken JL, Tanghe A | title = Dexetimide (R 16470) in the control of neuroleptic-induced extrapyramidal side-effects. Its prophylactic value and duration of action | journal = Psychiatria, Neurologia, Neurochirurgia | volume = 76 | issue = 4 | pages = 251–9 | year = 1973 | pmid = 4581374 }}
References
{{Reflist}}
{{Antiparkinson}}
{{Muscarinic acetylcholine receptor modulators}}
Category:Muscarinic antagonists
Category:Janssen Pharmaceutica
{{nervous-system-drug-stub}}