dexoxadrol
{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields = changed
| verifiedrevid = 460780081
| IUPAC_name = (2S)-2-[(4S)-2,2-Di(phenyl)-1,3-dioxolan-4-yl]piperidine
| image = Dioxadrol.svg
| width = 150
| tradename =
| legal_status = Legal
| routes_of_administration =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|correct|CAS}}
| CAS_number = 4741-41-7
| ATC_prefix = none
| ATC_suffix =
| PubChem = 3034023
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 2298576
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = JY5N9F45AG
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 1165411
| C=20 | H=23 | N=1 | O=2
| smiles = O1C[C@@H](OC1(c2ccccc2)c3ccccc3)[C@H]4NCCCC4
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C20H23NO2/c1-3-9-16(10-4-1)20(17-11-5-2-6-12-17)22-15-19(23-20)18-13-7-8-14-21-18/h1-6,9-12,18-19,21H,7-8,13-15H2/t18-,19+/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = HGKAMARNFGKMLC-RBUKOAKNSA-N
}}
Dexoxadrol (Dioxadrol) is a dissociative anaesthetic drug which has been found to be an NMDA antagonist and produces similar effects to PCP in animals. Dexoxadrol, along with another related drug etoxadrol, were developed as analgesics for use in humans, but development was discontinued after patients reported side effects such as nightmares and hallucinations.{{cite journal | vauthors = Sax M, Wünsch B | title = Relationships between the structure of dexoxadrol and etoxadrol analogues and their NMDA receptor affinity | journal = Current Topics in Medicinal Chemistry | volume = 6 | issue = 7 | pages = 723–32 | year = 2006 | pmid = 16719812 | doi = 10.2174/156802606776894483 }}{{cite journal | vauthors = Aepkers M, Wünsch B | title = Structure-affinity relationship studies of non-competitive NMDA receptor antagonists derived from dexoxadrol and etoxadrol | journal = Bioorganic & Medicinal Chemistry | volume = 13 | issue = 24 | pages = 6836–49 | date = December 2005 | pmid = 16169732 | doi = 10.1016/j.bmc.2005.07.030 }}
See also
- WMS-2539, a fluorinated derivative of dexoxadrol
References
{{reflist}}
{{Hallucinogens}}
{{Ionotropic glutamate receptor modulators}}
{{hallucinogen-stub}}