di-tert-butyl chromate

{{DISPLAYTITLE:Di-tert-butyl chromate}}

{{Chembox

| Name = tert-Butyl chromate

| ImageFile = (t-BuO)2CrO2.png

| ImageSize =

| ImageAlt =

| IUPACName = tert-Butyl chromate

| OtherNames = Di-tert-butyl ester of chromic acid; Bis(tert-butyl)chromate

| SystematicName =

| Section1 = {{Chembox Identifiers

| CASNo = 1189-85-1

| RTECS = GB2900000

| PubChem = 102059956

| PubChem_Comment = wrong formula

| SMILES = O([Cr](OC(C)(C)C)(=O)=O)C(C)(C)C

| ChemSpiderID = 11649895

| InChI = 1/2C4H9O.Cr.2O/c2*1-4(2,3)5;;;/h2*1-3H3;;;/q2*-1;+2;;/rC8H18CrO4/c1-7(2,3)12-9(10,11)13-8(4,5)6/h1-6H3

| InChIKey = PNWJTIFZRHJYLK-PZTLRDNSAU

| StdInChI = 1S/2C4H9O.Cr.2O/c2*1-4(2,3)5;;;/h2*1-3H3;;;/q2*-1;+2;;

| StdInChIKey = PNWJTIFZRHJYLK-UHFFFAOYSA-N

}}

| Section2 = {{Chembox Properties

| Formula = [(CH₃)₃CO]₂CrO₂

| MolarMass = 230.3 g/mol

| Appearance = red oil

| Density =

| MeltingPtC = -2.8

| MeltingPt_ref =

| BoilingPt =

| Solubility = Miscible

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

| IDLH = Ca [15 mg/m³ {as Cr(VI)}]{{PGCH|0080}}

| REL = Ca TWA 0.001 mg Cr(VI)/m³

| PEL = TWA 0.005 mg CrO3/m³ [skin]

}}

| Section4 =

| Section5 =

| Section6 =

}}

Di-tert-butyl chromate is an alkoxide with the formula CrO₂(OC(CH₃)₃)₂. It forms red crystals at temperatures below −5 °C, above which it melts to give a red oil.{{Citation|last=Freeman|first=Fillmore|date=2001-04-15|publisher=John Wiley & Sons, Ltd|language=en|doi=10.1002/047084289x.rd059m|isbn=978-0471936237|title=Encyclopedia of Reagents for Organic Synthesis|chapter=Di-tert-butyl Chromate}}{{cite journal |doi=10.1139/v75-438|title=Esters Chromiques Dérivés d'Alcools Tertiaires|year=1975|last1=Richer|first1=Jean-Claude|last2=Hachey|first2=Jean-Marie|journal=Canadian Journal of Chemistry|volume=53|issue=20|pages=3087–3093|doi-access=}} The complex, which is diamagnetic, is of fundamental interest as a model for the intermediates in oxidations of alcohols by chromium(VI). This complex is stable because as a t-butyl groups lack beta-hydrogens. This complex and its analogues have tetrahedral geometry at chromium, as established by X-ray crystallography of its analogues.{{cite journal |doi=10.1107/S0567740872004261|title=The crystal structure and absolute configuration of cedryl chromate|year=1972|last1=Amirthalingam|first1=V.|last2=Grant|first2=D. F.|last3=Senol|first3=A.|journal=Acta Crystallographica Section B: Structural Crystallography and Crystal Chemistry|volume=28|issue=5|pages=1340–1345}}{{cite journal |doi=10.1021/ic00335a009|title=Chromyl complexes with aryloxy and siloxy ligands|year=1990|last1=Stavropoulos|first1=Pericles|last2=Bryson|first2=Nathan|last3=Youinou|first3=Marie Therese|last4=Osborn|first4=John A.|journal=Inorganic Chemistry|volume=29|issue=10|pages=1807–1811}}