diacetamide
{{Chembox
| ImageFile = Diacetamide.svg
| ImageSize = 11o
| ImageAlt =
| IUPACName =
| OtherNames = bisacetylamine, N-acetylacetamide, diacetylamine
|Section1={{Chembox Identifiers
| CASNo = 625-77-4
| ChEMBL = 18986
| ChemSpiderID = 11760
| EC_number = 210-910-1
| PubChem = 12263
| UNII = M3GE4E3PRK
| StdInChI=1S/C4H7NO2/c1-3(6)5-4(2)7/h1-2H3,(H,5,6,7)
| StdInChIKey = ZSBDPRIWBYHIAF-UHFFFAOYSA-N
| SMILES = CC(=O)NC(=O)C
}}
|Section2={{Chembox Properties
| C=4|H=7|N=1|O=2
| MolarMass =
| RefractIndex =
| Appearance = white solid
| Density = 1.215 g/cm3{{cite journal|author=Y. Kuroda, Z. Taira, T. Uno, K. Osaki|journal=Cryst. Struct. Commun.|year=1975|volume=325|page=325|title=Diacetamide (trans-cis form) }}
| MeltingPtC = 79
| MeltingPt_notes =
| BoilingPtC = 220-222
| BoilingPt_notes =
| Solubility = }}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt = }}
}}
Diacetamide is an organic compound with the formula {{chem2|HN(COCH3)2}}. It can be classified as an imide. It is a white solid.
Diacetamide can be prepared by acetylation of acetamide.{{cite journal |doi=10.1039/jr9480001081 |title=213. Amides. Part I. Preparation of diacetimide |date=1948 |last1=Polya |first1=J. B. |last2=Tardrew |first2=P. L. |journal=Journal of the Chemical Society (Resumed) |page=1081 }} The compound serves as a bidentate O,O chelating ligand for a variety of metal ions.{{cite journal |doi=10.1021/ic50029a026 |title=Acyclic Imides as Ligands. I. Diacetamide Complexes of Manganese(II), Iron(II), Cobalt(II), Nickel(II), Copper(II), and Zinc (II) Perchlorates |date=1965 |last1=Kraihanzel |first1=Charles S. |last2=Grenda |first2=Stanley C. |journal=Inorganic Chemistry |volume=4 |issue=7 |pages=1037–1042 }}{{cite journal |doi=10.1016/0022-2860(76)85081-8 |title=Spectra and structure of iron(III) complexes with carbamide derivatives containing an acetyl group |date=1976 |last1=Massowska |first1=Joanna |last2=Cedzyńska |first2=Krystyna |journal=Journal of Molecular Structure |volume=33 |issue=2 |pages=183–189 |bibcode=1976JMoSt..33..183M }}