dianicline
{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 444161407
| IUPAC_name = (5aS,8S,10aR)-5a,6,9,10-Tetrahydro,7H,11H-8,10a-methanopyrido[2',3':5,6]pyrano[2,3-d]azepine
| image = Dianicline structure.svg
| image2 = Dianicline-3D-balls.png
| tradename =
| routes_of_administration =
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 292634-27-6
| ATC_prefix = none
| ATC_suffix =
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 187927
| PubChem = 9816447
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = Y0SNM34C6O
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 8352269
| C=13 | H=16 | N=2 | O=1
| smiles = C1CN2CC[C@@]3(C2)[C@H]1OC4=C(C3)N=CC=C4
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C13H16N2O/c1-2-11-10(14-5-1)8-13-4-7-15(9-13)6-3-12(13)16-11/h1-2,5,12H,3-4,6-9H2/t12-,13+/m0/s1
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = SUPRUPHAEXPGPF-QWHCGFSZSA-N
}}
Dianicline (SSR-591,813) is a drug developed by Sanofi-Aventis which acts as a partial agonist at neural nicotinic acetylcholine receptors. It is subtype-selective, binding primarily to the α4β2 subtype. It is being developed as a medication for the treatment of nicotine dependence to assist in smoking cessation.{{cite journal | vauthors = Cohen C, Bergis OE, Galli F, Lochead AW, Jegham S, Biton B, Leonardon J, Avenet P, Sgard F, Besnard F, Graham D, Coste A, Oblin A, Curet O, Voltz C, Gardes A, Caille D, Perrault G, George P, Soubrie P, Scatton B | display-authors = 6 | title = SSR591813, a novel selective and partial alpha4beta2 nicotinic receptor agonist with potential as an aid to smoking cessation | journal = The Journal of Pharmacology and Experimental Therapeutics | volume = 306 | issue = 1 | pages = 407–20 | date = July 2003 | pmid = 12682217 | doi = 10.1124/jpet.103.049262 | s2cid = 37543790 }} Dianicline is very similar to the already marketed drug varenicline and it is unclear what advantages it will have over the older drug, although it may have an improved side effect profile. It has been through human trials up to Phase II, although results have not yet been reported. Drug development has been discontinued after reporting of unfavourable results during Phase III trials.Fagerström K, Balfour DJK. Neuropharmacology and potential efficacy of new treatments for tobacco dependence. Expert Opinion on Investigational Drugs. 2006; 15(2):107-116.[http://clinicaltrials.gov/ct2/show/NCT00356967 Efficacy and Safety of Dianicline Versus Placebo as an Aid to Smoking Cessation]{{Cite web |url=http://www.en.sanofi-aventis.com/binaries/080212_PDF_Slides_media_tcm28-15767.pdf |title=Sanofi Pipeline |access-date=2009-06-24 |archive-url=https://web.archive.org/web/20081204130421/http://www.en.sanofi-aventis.com/binaries/080212_PDF_Slides_media_tcm28-15767.pdf |archive-date=2008-12-04 |url-status=dead }}
References
{{Reflist|2}}
{{Stimulants}}
{{Drugs used in addictive disorders}}
{{Nicotinic acetylcholine receptor modulators}}
Category:Bridged heterocyclic compounds