dibunate

{{Short description|Chemical compound}}

{{Drugbox

| Watchedfields = changed

| verifiedrevid = 443636145

| IUPAC_name = 2,6-Di-tert-butylnaphthalene-1-sulfonic acid

| image = Dibunate.png

| tradename = Aducin, Becantal, Becantex, Bechisan, Bexedyl, Keuten, Linctussal, Pectoro

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 14992-58-6

| ATC_prefix = R05

| ATC_suffix = DB16

| PubChem = 84746

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB13796

| ChEBI = 145567

| ChEMBL = 1865134

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 76450

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = ZXY319VL5S

| KEGG = D01700

| C=18 | H=24 | O=3 | S=1

| smiles = O=S(=O)(O)c1c2c(ccc1C(C)(C)C)cc(cc2)C(C)(C)C

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C18H24O3S/c1-17(2,3)13-8-9-14-12(11-13)7-10-15(18(4,5)6)16(14)22(19,20)21/h7-11H,1-6H3,(H,19,20,21)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = WBEBQCINXJDZCX-UHFFFAOYSA-N

}}

Dibunate is a cough suppressant.{{cite journal | vauthors = Sevelius H, Colmore JP | title = Antitussive effect of ethyl dibunate in patients with chronic cough | journal = Clinical Pharmacology and Therapeutics | volume = 8 | issue = 3 | pages = 381–4 | year = 1967 | pmid = 5338382 | doi = 10.1002/cpt196783381 }} As the sodium salt, it has been marketed under the name Becantyl (in the United Kingdom), Becantex (in continental Europe), or Linctussal with a dosage of 20 to 30 mg, as either syrup or tablets.

{{cite journal |title=To-day's drugs: Cough suppressants |date=May 2, 1964 |journal=Br Med J |page=1165-1167 |volume=1 |issue=5391 |pmid=14120813 |pmc=1813498}}

Similar to benzonatate, it is a peripherally acting drug. It has not been reported to cause sedation, euphoria, habituation, or respiratory depression, unlike narcotic antitussives such as codeine. It may work by blocking afferent signals in the reflex arc which controls cough.

{{cite journal | vauthors = Simon SW | title = A comparative study of two new non-narcotic antitussive drugs | journal = Ohio State Med J | volume = 53 | issue = 12 | page = 1426-7 | year = 1957 | pmid = 13493953 | url = https://archive.org/details/ohiostatemedical5311ohio}} Nausea is rarely seen as an adverse effect.{{cite book |isbn=0-8103-7177-4 |title=Drugs Available Abroad, 1st Edition |page=63 |date=1991 | vauthors = Schlesser JL |publisher=Derwent Publications Ltd.}}