dichloro(cycloocta-1,5-diene)platinum(II)

{{chembox

|verifiedrevid = 396330050

|ImageFile=Cl2Ptcod.png

|ImageSize=150

|ImageFile1=Dichloro(cycloocta-1,5-diene)platinum(II)-from-xtal-3D-balls-A.png

|Section1={{Chembox Identifiers

|ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

|ChemSpiderID = 4642949

|EC_number = 235-144-5

|InChI = 1/C8H12.2ClH.Pt/c1-2-4-6-8-7-5-3-1;;;/h1-2,7-8H,3-6H2;2*1H;/q;;;+2/p-2/b2-1-,8-7-;;;

|InChIKey = VVAOPCKKNIUEEU-AUZMAREFBX

|StdInChI_Ref = {{stdinchicite|correct|chemspider}}

|StdInChI = 1S/C8H12.2ClH.Pt/c1-2-4-6-8-7-5-3-1;;;/h1-2,7-8H,3-6H2;2*1H;/q;;;+2/p-2/b2-1-,8-7-;;;

|StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

|StdInChIKey = VVAOPCKKNIUEEU-PHFPKPIQSA-L

|CASNo_Ref = {{cascite|correct|CAS}}

|CASNo=12080-32-9

|PubChem=5702648

|SMILES = Cl[Pt]Cl.C\1=C\CC/C=C\CC/1

}}

|Section2={{Chembox Properties

|C=8 | H=12 | Cl=2 | Pt=1

|MeltingPtC=285

}}

|Section3={{Chembox Hazards

|GHSPictograms = {{GHS07}}

|GHSSignalWord = Warning

|HPhrases = {{H-phrases|315|319|335}}

|PPhrases = {{P-phrases|261|264|271|280|302+352|304+340|305+351+338|312|321|332+313|337+313|362|403+233|405|501}}

}}

}}

Dichloro(1,5-cyclooctadiene)platinum(II) (Pt(cod)Cl₂) is an organometallic compound of platinum. This colourless solid is an entry point to other platinum compounds through the displacement of the cod and/or chloride ligands. It is one of several complexes of cycloocta-1,5-diene.

Dichloro(1,5-cyclooctadiene)platinum(II) is prepared by treating potassium tetrachloroplatinate with the diene:{{cite journal |author1=E. Costa |author2=P. G. Pringle |author3=M. Ravetz | title = [(1,2,5,6-η)-1,5-Cyclooctadiene]Dimethyl-Platinum(II)| journal = Inorg. Synth. | year = 1997 | volume = 31 | pages = 284–286 | doi = 10.1002/9780470132623.ch49 | isbn = 978-0-470-13262-3}}

:K₂PtCl₄ + C₈H₁₂ → PtCl₂C₈H₁₂ + 2 KCl

File:PtCl2codStrem.jpg

According to X-ray crystallography, the complex is square planar.{{cite journal|journal=Inorganica Chimica Acta|volume=65|year=1982|pages=L205–L206|title=Chemistry of Metal diene complexes: X-ray crystal structure of dichloro(1,5-cyclooctadine)platinum(II)|author=Anil B. Goel |author2=Sarla Goel |author3=Don Van Der Veer |doi=10.1016/S0020-1693(00)93548-5}}{{cite journal | title = Reexamination of the π bonding in dichloro(cycloocta-1,5-diene)platinum |author1=Ashfaquzzaman Syed |author2=Edwin D. Stevens |author3=Sandra G. Cruz | journal = Inorg. Chem. | year = 1984 | volume = 23 | issue = 22 | pages = 3673–3674 | doi = 10.1021/ic00190a053}}