dichloromethyl methyl ether

{{Chembox

| ImageFile = Dichloromethyl methyl ether.svg

| ImageSize = 150px

| PIN = Dichloro(methoxy)methane

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 4885-02-3

| PubChem = 21004

| ChemSpiderID = 19757

| SMILES = ClC(Cl)OC

| InChI = InChI=1S/C2H4Cl2O/c1-5-2(3)4/h2H,1H3

}}

|Section2={{Chembox Properties

| C=2 | H=4 | Cl=2 | O=1

| Appearance =

| Density =

| MeltingPt =

| BoilingPt = 85°C

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Dichloromethyl methyl ether (HCl₂COCH₃) is an organic compound that belongs to the class of ethers with a dichloromethyl group and a methyl group. It can be synthesized from methyl formate and a mixture of phosphorus pentachloride and phosphorus oxychlorideOrganic Syntheses, Coll. Vol. 5, p.365 (1973); Vol. 47, p.51 (1967). [http://www.orgsyn.org/demo.aspx?prep=cv5p0365 link] or by chlorination of chlorodimethyl ether.

The compound is used in the formylation of aromatic compounds (Rieche formylation) and as a chlorination agent in the formation of acid chlorides.Organic Syntheses, Coll. Vol. 7, p.467 (1990); Vol. 61, p.1 (1983). [http://www.orgsyn.org/demo.aspx?prep=cv7p0467 Link]