dichlorophen

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 446639999

| IUPAC_name = 4-Chloro-2-[(5-chloro-2-hydroxyphenyl)methyl]phenol

| image = Dichlorophen.svg

| image2 = Dichlorophen molecule ball.png

| width2 = 200

| alt2 = Ball-and-stick mode of the dichlorophen molecule

| tradename =

| Drugs.com = {{drugs.com|international|dichlorophen}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 97-23-4

| ATC_prefix = P02

| ATC_suffix = DX02

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| PubChem = 3037

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 2929

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = T1J0JOU64O

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = C14292

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 33845

| C=13 | H=10 | Cl=2 | O=2

| smiles = C1=CC(=C(C=C1Cl)CC2=C(C=CC(=C2)Cl)O)O

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C13H10Cl2O2/c14-10-1-3-12(16)8(6-10)5-9-7-11(15)2-4-13(9)17/h1-4,6-7,16-17H,5H2

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = MDNWOSOZYLHTCG-UHFFFAOYSA-N

| density = 1.5 g/cm³

| melting_point = 177.5

| solubility = 0.003 g/100 mL{{cite book | vauthors = Lide DR | year = 1998 | title = Handbook of Chemistry and Physics | edition = 87 | location = Boca Raton, Florida | publisher = CRC Press | isbn = 0-8493-0594-2 | pages = 8–118 }}

}}

Dichlorophen is an anticestodal agent, fungicide, germicide, and antimicrobial agent.Milne, G.W.A. (Ed.). (2005). Gardner's commercially important chemicals: Synonyms, trade names, and properties. Hoboken, N.J.: Wiley-Interscience. [https://books.google.com/books?id=oWdc2qcb3QsC&pg=PA201 Google Books] It is used in combination with toluene for the removal of parasites such as ascarids, hookworms, and tapeworms from dogs and cats.{{Citation | title=Code of Federal Regulations | url= http://frwebgate1.access.gpo.gov/cgi-bin/TEXTgate.cgi?WAISdocID=220114194717+2+1+0&WAISaction=retrieve| work= Code of Federal Regulations, Title 21, Volume 6| publisher=U.S. Government Printing Office | date= 2005-04-01| access-date=2009-05-01}}