dicirenone

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = Propan-2-yl (7R,8R,9S,10R,13S,14S,17R)-10,13-Dimethyl-3,5'-dioxospiro[2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17,2'-oxolane]-7-carboxylate

| image = Dicirenone.svg

| width =

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration = Oral

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref =

| CAS_number = 41020-79-5

| CAS_supplemental =

| class =

| ATC_prefix =

| ATC_suffix =

| ATC_supplemental =

| PubChem = 10387872

| IUPHAR_ligand =

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID_Ref =

| ChemSpiderID = 8563314

| UNII = M8K306YKSX

| KEGG = D03792

| ChEBI =

| ChEMBL = 2106258

| C=26 | H=36 | O=5

| SMILES = CC(C)OC(=O)[C@@H]1CC2=CC(=O)CC[C@@]2([C@@H]3[C@@H]1[C@@H]4CC[C@]5([C@]4(CC3)C)CCC(=O)O5)C

| StdInChI_Ref =

| StdInChI = 1S/C26H36O5/c1-15(2)30-23(29)18-14-16-13-17(27)5-9-24(16,3)19-6-10-25(4)20(22(18)19)7-11-26(25)12-8-21(28)31-26/h13,15,18-20,22H,5-12,14H2,1-4H3/t18-,19+,20+,22-,24+,25+,26-/m1/s1

| StdInChIKey_Ref =

| StdInChIKey = WUVPAYPBMZMHJO-IMNLCBETSA-N

| synonyms = SC-26304; 7α-Carboxyisopropylspirolactone; 17α-Hydroxy-3-oxopregn-4-ene-7α,21-dicarboxylic acid γ-lactone 1-isopropyl ester

}}

Dicirenone (INN, USAN; developmental code name SC-26304; also known as 7α-carboxyisopropylspirolactone) is a synthetic, steroidal antimineralocorticoid of the spirolactone group which was developed as a diuretic and antihypertensive agent but was never marketed.{{cite book | vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA387|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=387–}}{{cite book| vauthors = Morton IK, Hall JM |title=Concise Dictionary of Pharmacological Agents: Properties and Synonyms|url=https://books.google.com/books?id=tsjrCAAAQBAJ&pg=PA97|date=6 December 2012|publisher=Springer Science & Business Media|isbn=978-94-011-4439-1|pages=97–}} It was synthesized and assayed in 1974. Similarly to other spirolactones like spironolactone, dicirenone also possesses antiandrogen activity, albeit with relatively reduced affinity.{{cite journal | vauthors = Netchitailo P, Delarue C, Perroteau I, Leboulenger F, Capron MH, Vaudry H | title = Relative inhibitory potency of five mineralocorticoid antagonists on aldosterone biosynthesis in vitro | journal = Biochemical Pharmacology | volume = 34 | issue = 2 | pages = 189–194 | date = January 1985 | pmid = 2981534 | doi = 10.1016/0006-2952(85)90123-6 }}