diethylene glycol dinitrate

{{chembox

| Watchedfields = changed

| verifiedrevid = 445844227

| Name = Diethylene glycol dinitrate

| ImageFile1 = Diethylene glycol dinitrate.png

| ImageSize1 =

| PIN = Oxydi(ethane-2,1-diyl) dinitrate

| OtherNames = Diethyleneglycol dinitrate
Diethyl glycol dinitrate
Oxydiethylene dinitrate
DEGDN

| Section1 = {{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 55142

| InChI = 1/C4H8N2O7/c7-5(8)12-3-1-11-2-4-13-6(9)10/h1-4H2

| InChIKey = LYAGTVMJGHTIDH-UHFFFAOYAD

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C4H8N2O7/c7-5(8)12-3-1-11-2-4-13-6(9)10/h1-4H2

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = LYAGTVMJGHTIDH-UHFFFAOYSA-N

| CASNo_Ref = {{cascite|correct|??}}

| CASNo=693-21-0

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 77W50O99G1

| PubChem=61198

| UNNumber = 0075

| SMILES=C(CO[N+](=O)[O-])OCCO[N+](=O)[O-]

}}

| Section2 = {{Chembox Properties

| C=4 | H=8 | N=2 | O=7

| Appearance= Colorless oily liquid

| Odor = Odorless

| Density=1.4092 g/mL (0 °C)
1.3846 g/mL (20 °C)

| MeltingPtC=-11.5

| BoilingPtC=197

| BoilingPt_notes = (decomposes)

| Solubility=4.1 g/L (24 °C)

| VaporPressure = 0.007 mmHg (22.4 °C)

| SolubleOther = Soluble in methanol, acetic acid

}}

| Section3 = {{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

}}

}}

Diethylene glycol dinitrate (DEGDN) is an explosive nitrated alcohol ester with the formula C₄H₈N₂O₇. It is commonly used as a plasticizer in propellant or explosive formulations.{{Cite book |last=Kubota |first=Naminosuke |title=Propellants and explosives: thermochemical aspects of combustion |date=2015 |publisher=Wiley-VCH |isbn=978-3-527-69348-1 |edition=3 |location=Weinheim}} While chemically similar to numerous other high explosives, pure diethylene glycol dinitrate is difficult to ignite. Ignition typically requires localized heating to the decomposition point unless the DEGDN is first atomized. It is sensitive to detonation by impact but not due to friction.{{Cite journal |last=Hoque |first=Ehtasimul |last2=Pant |first2=Chandra Shekhar |last3=Das |first3=Sushanta |date=2020-03-09 |title=Study on Friction Sensitivity of Passive and Active Binder based Composite Solid Propellants and Correlation with Burning Rate |url=https://publications.drdo.gov.in/ojs/index.php/dsj/article/view/14802 |journal=Defence Science Journal |volume=70 |issue=2 |pages=159–165 |doi=10.14429/dsj.70.14802 |issn=0976-464X|doi-access=free }}