diffractaic acid

{{Short description|Chemical compound produced by lichens}}

{{Chembox

| ImageFile = Diffractaic acid.svg

| ImageSize = 200px

| ImageAlt =

| IUPACName = 4-(2,4-dimethoxy-3,6-dimethylbenzoyl)oxy-2-hydroxy-3,6-dimethylbenzoic acid{{cite journal |title=Diffractaic acid |journal=Pubchem.ncbi.NLM.nih.gov |url=https://pubchem.ncbi.nlm.nih.gov/compound/Diffractaic-acid#section=Names-and-Identifiers |language=en}}

| OtherNames = Diffractic acid, Dirbizomic acid, Dirhizomic acid, NSC 5901,{{cite journal |title=Diffractaic Acid (CAS 436-32-8) |website=www.caymanchem.com |url=https://www.caymanchem.com/product/24208 |language=en}} NSC 685595

| Section1 = {{Chembox Identifiers

| CASNo = 436-32-8

| CASNo_Ref = {{Cascite|correct|CAS}}

| ChEBI =

| ChEMBL = 367741

| ChemSpiderID = 85597

| EINECS =

| PubChem = 94870

| UNII =

| SMILES = O=C(O)C1=C(O)C(C)=C(OC(C2=C(OC)C(C)=C(OC)C=C2C)=O)C=C1C

| StdInChI=1S/C20H22O7/c1-9-8-14(11(3)17(21)15(9)19(22)23)27-20(24)16-10(2)7-13(25-5)12(4)18(16)26-6/h7-8,21H,1-6H3,(H,22,23)

| StdInChIKey= MIJKZXWOOXIEEU-UHFFFAOYSA-N

| StdInChIKey_Ref=

}}

| Section2 = {{Chembox Properties

| C=20 | H=22 | O=7

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

| synonyms =

}}

}}

Diffractaic acid is a β-orcinol depside with the molecular formula C₂₀H₂₂O₇, which is produced by lichens.{{cite book |last1=Sukumaran |first1=Swapna Thacheril |last2=Sugathan |first2=Shiburaj |last3=Abdulhameed |first3=Sabu |title=Plant Metabolites: Methods, Applications and Prospects |date=28 November 2020 |publisher=Springer Nature |isbn=978-981-15-5136-9 |page=265 |language=en}}{{cite journal |last1=Demir |first1=Leyla |last2=Toğar |first2=Başak |last3=Türkez |first3=Hasan |last4=Sozio |first4=Piera |last5=Aslan |first5=Ali |last6=Stefano |first6=Antonio Di |title=The investigation of cytogenetic and oxidative effects of diffractaic acid on human lymphocyte cultures |journal=Brazilian Archives of Biology and Technology |year=2015 |volume=58 |pages=75–81 |doi=10.1590/S1516-8913201502752 |language=en |issn=1516-8913|doi-access=free }} Diffractaic acid has cytotoxic, cytogenetic, oxidative, analgesic and antiviral effects.

The foliose lichen species Punctelia diffractaica is named for the presence of this compound.{{cite journal |last1=Kurokawa |first1=S. |year=1999 |title=Notes on Flavopunctelia and Punctelia (Parmeliaceae), with descriptions of four new species |journal=Bulletin of the Botanical Garden of Toyama |volume=4 |pages=25–32}}