diformylcresol

{{Chembox

| ImageFile = Diformylcresol.svg

| ImageSize = 190

| ImageAlt =

| IUPACName = 2-hydroxy-5-methylisophthalaldehyde

| OtherNames = 2,6-diformyl-4-methylphenol
2-hydroxy-5-methyl-1,3-benzenedicarboxaldehyde

|Section1={{Chembox Identifiers

| CASNo = 7310-95-4

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = V6R37R6AU3

| ChEMBL = 3904097

| ChemSpiderID = 73760

| EINECS = 230-768-4

| PubChem = 81744

| StdInChI=1S/C9H8O3/c1-6-2-7(4-10)9(12)8(3-6)5-11/h2-5,12H,1H3

| StdInChIKey = ZBOUXALQDLLARY-UHFFFAOYSA-N

| SMILES = CC1=CC(=C(C(=C1)C=O)O)C=O

}}

|Section2={{Chembox Properties

| C = 9 | H = 8 | O = 3

| MolarMass =

| Appearance = white solid

| Density = 1.433 g/cm³{{cite journal |doi=10.1515/ncrs-2014-0171|title=Redetermination of the crystal structure of 2,6-diformyl-4-methylphenol, at 200 K, C9H8O3|year=2014|last1=Habarurema|first1=Gratien|last2=Gerber|first2=Thomas I. A.|last3=Hosten|first3=Eric|last4=Betz|first4=Richard|journal=Zeitschrift für Kristallographie - New Crystal Structures|volume=229|issue=4|pages=331–332|s2cid=93304005|doi-access=free}}

| MeltingPtC = 113

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| GHSPictograms = {{GHS07}}

| GHSSignalWord = Warning

| HPhrases = {{H-phrases|315|319|335}}

| PPhrases = {{P-phrases|261|264|271|280|302+352|304+340|305+351+338|312|321|332+313|337+313|362|403+233|405|501}}

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Diformylcresol is an organic compound with the formula CH₃C₆H₂(CHO)₂OH. The 2,6-diformyl derivative of p-cresol is the most common isomer and is a white solid at room temperature.

Diformylcresol condenses with amines to give diimines that are widely studied as binucleating ligands.{{cite journal |doi=10.1021/IC9514197|title=Magnetostructural Correlations in Bis(μ₂-phenoxide)-Bridged Macrocyclic Dinuclear Copper(II) Complexes. Influence of Electron-Withdrawing Substituents on Exchange Coupling|year=1996|last1=Thompson|first1=Laurence K.|last2=Mandal|first2=Sanat K.|last3=Tandon|first3=Santokh S.|last4=Bridson|first4=John N.|last5=Park|first5=Murray K.|journal=Inorganic Chemistry|volume=35|issue=11|pages=3117–3125|pmid=11666507}}{{cite journal |doi=10.1021/ja00404a017|title=The Synthesis, Redox Properties, and Ligand Binding of Heterobinuclear Transition-Metal Macrocyclic Ligand Complexes. Measurement of an Apparent Delocalization Energy in a Mixed-Valent Cu^ICu^II Complex|year=1981|last1=Gagne|first1=R. R.|last2=Spiro|first2=C. L.|last3=Smith|first3=T. J.|last4=Hamann|first4=C. A.|last5=Thies|first5=W. R.|last6=Shiemke|first6=A. D.|journal=Journal of the American Chemical Society|volume=103|issue=14|pages=4073–4081}}