diisodecyl phthalate

{{Chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 441501081

| ImageFile = Diisodecyl phthalate.svg

| ImageSize = 220px

| ImageFile2 = Diisodecyl phthalate 3D BS.png

| ImageSize2 = 220px

| PIN = Bis(8-methylnonyl) benzene-1,2-dicarboxylate

| OtherNames = Bis(8-methylnonyl) phthalate
Bis(isodecyl) phthalate

|Section1={{Chembox Identifiers

| CASNo = 26761-40-0

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = WF93T741QI

| PubChem = 33599

| ChemSpiderID = 30996

| StdInChI = 1S/C28H46O4/c1-23(2)17-11-7-5-9-15-21-31-27(29)25-19-13-14-20-26(25)28(30)32-22-16-10-6-8-12-18-24(3)4/h13-14,19-20,23-24H,5-12,15-18,21-22H2,1-4H3

| StdInChIKey = ZVFDTKUVRCTHQE-UHFFFAOYSA-N

| SMILES = O=C(OCCCCCCCC(C)C)C1=CC=CC=C1C(OCCCCCCCC(C)C)=O}}

|Section2={{Chembox Properties

| C=28|H=46|O=4

| Appearance =

| Density = 0.96-0.97 g/cm3 at 20 °C{{GESTIS|ZVG=35170|CAS=26761-40-0|Date=Sep 27, 2007}}

| MeltingPtC = −50

| MeltingPt_ref =

| BoilingPtC = 250 to 257

| BoilingPt_notes = at 0.5 kPa {{cite web|last=NIOSH|title=International Chemical Safety Cards|url=https://www.cdc.gov/niosh/ipcsneng/neng0875.html|publisher=NIOSH|access-date=2017-09-09|archive-url=https://web.archive.org/web/20170614213534/https://www.cdc.gov/niosh/ipcsneng/neng0875.html|archive-date=2017-06-14|url-status=dead}}

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Diisodecyl phthalate (DIDP) is a commonly used plasticizer used in the production of plastic and plastic coating to increase flexibility. It is a mixture of compounds derived from the esterification of phthalic acid and isomeric decyl alcohols.

The coating on furnishings, cookware, pharmaceutical pills, food wrappers and many other products may have DIDP or other phthalates in them. There has been recent concern in the US and European Union for their toxicity and bioaccumulative quality. The European Union has set a maximum specific migration limit (SML) from food contact materials of 9 mg/kg food for the sum of diisodecyl phthalates and diisononyl phthalates.{{cite web|title=EU legislative list for food contact materials|url=http://ec.europa.eu/food/food/chemicalsafety/foodcontact/legisl_list_en.htm}}

DIDP has been listed since 2007 under Proposition 65 as a substance known to the state of California to cause reproductive toxicity.{{cite web|title=OEHHA Proposition 65 List of Chemicals|url=http://oehha.ca.gov/prop65/prop65_list/Newlist.html}} The similar compound DINP is also listed.

In 2013, ECHA's Risk Assessment Committee (RAC) concluded that Di-isodecyl phthalate (DIDP) does not warrant classification for reprotoxic effects under the EU's Classification, Labelling and Packaging (CLP) regulation.{{cite web |title=Evaluation of new scientific evidence concerning DINP and DIDP |url=https://echa.europa.eu/documents/10162/31b4067e-de40-4044-93e8-9c9ff1960715 |website=European Chemicals Agency |archive-url=https://web.archive.org/web/20220901073958/https://echa.europa.eu/documents/10162/31b4067e-de40-4044-93e8-9c9ff1960715 |archive-date=2022-09-01 |url-status=live |access-date=2020-01-26 }}

See also

  • DPHP, a similar phthalate ester

References

{{Reflist}}

{{HealthIssuesOfPlastics}}

Category:Plasticizers

Category:Phthalate esters