diisopropanolamine
{{Distinguish|Diisopropylamine}}
{{Chembox
| ImageFile = Diisopropanolamine.svg
| ImageSize = 200px
| ImageAlt =
| IUPACName = 1-(2-Hydroxypropylamino)propan-2-ol
| OtherNames = DIPA; Bis(2-hydroxypropyl)amine
| Section1 = {{Chembox Identifiers
| CASNo = 110-97-4
| CASNo_Ref = {{cascite|correct|CAS}}
| ChemSpiderID = 7795
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 0W44HYL8T5
| ChEBI = 143266
| PubChem = 8086
| SMILES = CC(CNCC(C)O)O
| InChI=1S/C6H15NO2/c1-5(8)3-7-4-6(2)9/h5-9H,3-4H2,1-2H3
| InChIKey=LVTYICIALWPMFW-UHFFFAOYSA-N
}}
| Section2 = {{Chembox Properties
| C=6|H=15|N=1|O=2
| Appearance = White solid{{GESTIS|ZVG=17860}}
| Density = 0.99 g/cm3 (42 °C)
| MeltingPtC = 42
| BoilingPtC = 249
| Solubility =
}}
| Section3 = {{Chembox Hazards
| MainHazards =
| FlashPtC = 135
| AutoignitionPt =
}}
}}
Diisopropanolamine is a chemical compound with the molecular formula C6H15NO2, used as an emulsifier, stabilizer, and chemical intermediate.{{Cite web | url = http://msdssearch.dow.com/PublishedLiteratureDOWCOM/dh_005c/0901b8038005c440.pdf?filepath=amines/pdfs/noreg/111-01413.pdf | title = Technical Data Sheet: Dow Isopropanolamine | publisher = Dow Chemical }}
Diisopropanolamine can be prepared by the reaction of isopropanolamine or ammonia with propylene oxide.{{Cite web |url=http://www.ccme.ca/files/Resources/supporting_scientific_documents/dipa_ssd_soil_water1.0_e.pdf |title=Canadian Soil and Water Quality Guidelines for Diisopropanolamine (Canadian Council of Ministers of the Environment 2006) |access-date=2017-01-14 |archive-date=2015-10-18 |archive-url=https://web.archive.org/web/20151018033546/http://www.ccme.ca/files/Resources/supporting_scientific_documents/dipa_ssd_soil_water1.0_e.pdf |url-status=dead }}
File:Diisopropanolamine synthese.png{{clear-left}}
