dinoxyline

{{Short description|Chemical compound}}

{{Drugbox

| verifiedrevid = 449581671

| IUPAC_name = 8,9-dihydroxy-1,2,3,11b-tetrahydrochromeno[4,3,2,-de]isoquinoline

| image = Dinoxyline Structure.svg

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 757176-96-8

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 9T7B8CV47A

| ATC_prefix = none

| ATC_suffix =

| PubChem = 9819126

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID = 7994875

| C=15 | H=13 | N=1 | O=3

| smiles = c3ccc(Oc24)c1c3CNCC1c4ccc(O)c2O

| StdInChI = 1S/C15H13NO3/c17-11-5-4-9-10-7-16-6-8-2-1-3-12(13(8)10)19-15(9)14(11)18/h1-5,10,16-18H,6-7H2

| StdInChIKey = QOHSTVKJXZTEOL-UHFFFAOYSA-N

}}

Dinoxyline is a synthetic compound developed for scientific research, which acts as a potent full agonist at all five dopamine receptor subtypes.{{cite journal |vauthors=Grubbs RA, Lewis MM, Owens-Vance C, Gay EA, Jassen AK, Mailman RB, Nichols DE |title=8,9-dihydroxy-1,2,3,11b-tetrahydrochromeno[4,3,2,-de]isoquinoline (dinoxyline), a high affinity and potent agonist at all dopamine receptor isoforms |journal=Bioorganic & Medicinal Chemistry |volume=12 |issue=6 |pages=1403–12 |date=March 2004 |pmid=15018913 |doi=10.1016/j.bmc.2004.01.008 }}{{cite journal |vauthors=Ryman-Rasmussen JP, Nichols DE, Mailman RB |title=Differential activation of adenylate cyclase and receptor internalization by novel dopamine D1 receptor agonists |journal=Molecular Pharmacology |volume=68 |issue=4 |pages=1039–48 |date=October 2005 |pmid=15985612 |doi=10.1124/mol.105.012153 |s2cid=14398107 }}{{cite journal |vauthors=Zhang J, Xiong B, Zhen X, Zhang A |title=Dopamine D1 receptor ligands: where are we now and where are we going |journal=Medicinal Research Reviews |volume=29 |issue=2 |pages=272–94 |date=March 2009 |pmid=18642350 |doi=10.1002/med.20130 |s2cid=25334596 }}