diodone

{{Short description|Chemical compound}}

{{Drugbox

| drug_name =

| IUPAC_name = (3,5-Diiodo-4-oxo-1(4H)-pyridinyl)acetic acid

| image = Diodone.svg

| alt =

| caption =

| tradename =

| Drugs.com =

| MedlinePlus =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category=

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 101-29-1

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = NLX9TZ649P

| PubChem = 9304

| ChemSpiderID = 8945

| ATCvet =

| ATC_prefix = V08

| ATC_suffix = AA10

| DrugBank = DB13568

| KEGG = DG01178

| synonyms = Iodopyracet, pelvirinic acid, umbradilic acid

| C=7 | H=5 | I=2 | N=1 | O=3

| smiles = O=C(O)CN/1/C=C(/I)C(=O)C(\I)=C\1

| StdInChI = 1S/C7H5I2NO3/c8-4-1-10(3-6(11)12)2-5(9)7(4)13/h1-2H,3H2,(H,11,12)

| StdInChIKey = PVBALTLWZVEAIO-UHFFFAOYSA-N

}}

Diodone is a radiocontrast agent that was used in urography.{{cite journal | vauthors = Wilson DM, Apter JT, Schwartz FD | author-link2=Julia T. Apter|title = A model for measuring renal blood flow from plasma disappearance of iodopyracet | journal = Journal of Applied Physiology | volume = 28 | issue = 1 | pages = 79–88 | date = January 1970 | pmid = 5409794 | doi = 10.1007/BF00698048 | s2cid = 9165082 }} It was usually formulated as a salt with diethanolamine.