diphemanil metilsulfate

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 470455243

| IUPAC_name = 4-(Diphenylmethylene)-1,1-dimethylpiperidinium methylsulfate

| image = Diphemanil metilsulfate.png

| drug_name =

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 62-97-5

| CAS_supplemental =
{{CAS|15394-62-4}} (diphemanil cation)

| ATC_prefix = A03

| ATC_suffix = AB15

| PubChem = 6126

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB00729

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 5896

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = W2ZG23MGYI

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 59782

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1200880

| C=21 | H=27 | N=1 | O=4 | S=1

| smiles = [O-]S(=O)(=O)OC.c3c(\C(=C1/CC[N+](C)(C)CC1)c2ccccc2)cccc3

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C20H24N.CH4O4S/c1-21(2)15-13-19(14-16-21)20(17-9-5-3-6-10-17)18-11-7-4-8-12-18;1-5-6(2,3)4/h3-12H,13-16H2,1-2H3;1H3,(H,2,3,4)/q+1;/p-1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = BREMLQBSKCSNNH-UHFFFAOYSA-M

}}

In the field of pharmacology, diphemanil metilsulfate also known as diphemanil methylsulfate is an antimuscarinic (an agent that blocks the action of the natural neurotransmitter acetylcholine).{{cite journal | vauthors = Finkbeiner AE, Bissada NK, Welch LT | title = Uropharmacology: part VI. Parasympathetic depressants | journal = Urology | volume = 10 | issue = 5 | pages = 503–10 | date = November 1977 | pmid = 21482 | doi = 10.1016/0090-4295(77)90149-2 }}