diphosphorus tetrachloride
{{chembox
| Verifiedfields =
| Watchedfields =
| verifiedrevid =
| ImageFile = P2F4-mol-3d.png
| ImageSize = 100px
| IUPACName =
| OtherNames =
| Name =
|Section1={{Chembox Identifiers
| Abbreviations =
| CASNo_Ref = {{cascite|correct|??}}
| CASNo = 13497-91-1
| EINECS =
| PubChem = 139480
| RTECS =
| MeSHName =
| ChemSpiderID = 123003
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI =
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG =
| StdInChI=1S/Cl4P2/c1-5(2)6(3)4
| StdInChIKey = SWRNIYAQKATHDJ-UHFFFAOYSA-N
| SMILES = P(P(Cl)Cl)(Cl)Cl
}}
|Section2={{Chembox Properties
| Formula = {{Chem2|P2Cl4}}
| MolarMass =
| Appearance = colorless liquid
| Density =
| MeltingPtK = 245
| MeltingPt_notes =
| BoilingPtK = 453
| BoilingPt_notes =
| Solubility =
| SolubleOther =
| Solvent =
| pKa =
| pKb = }}
|Section3={{Chembox Structure
| CrystalStruct =
| Coordination =
| MolShape = }}
|Section4={{Chembox Thermochemistry
| DeltaHf =
| DeltaHc =
| Entropy =
| HeatCapacity = }}
|Section6={{Chembox Explosive
| ShockSens =
| FrictionSens =
| DetonationV =
| REFactor = }}
|Section7={{Chembox Hazards
| ExternalSDS =
| MainHazards =
| NFPA-H =
| NFPA-F =
| NFPA-R =
| NFPA-S =
| FlashPt =
| AutoignitionPt =
| ExploLimits =
| PEL = }}
|Section8={{Chembox Related
| OtherAnions = Diphosphorus tetrafluoride
Diphosphorus tetraiodide
| OtherCations =
| OtherFunction =
| OtherFunction_label =
| OtherCompounds = Diphosphorus tetrafluoride
Diphosphorus tetraiodide}}
}}
Diphosphorus tetrachloride is an inorganic compound with a chemical formula {{chem2|P2Cl4}}. It is a colorless liquid that decomposes near room temperature and ignites in air.{{cite journal |doi=10.1002/zaac.19936190135|title=Eine neue Synthese von Tetrachlordiphosphan sowie Untersuchungen zur 1,2-Addition an Cycloalkene|year=1993|last1=Driess|first1=M.|last2=Haiber|first2=G.|journal=Zeitschrift für Anorganische und Allgemeine Chemie|volume=619|pages=215–219}}
Production
It was first prepared in 1910 by Gauthier by the following reaction:
:{{chem2|2 PCl3 + H2 -> P2Cl4 + 2 HCl}}
An improved method involves coevaporation of phosphorus trichloride and copper, as described by the following:
:{{chem2|2 PCl3 + 2 Cu -> P2Cl4 + 2 CuCl}}
Reactions
Near room temperature, the compound degrades to give phosphorus trichloride and an ill-defined phosphorus monochloride:
:{{chem2|P2Cl4 -> PCl3 + 1/n [PCl]n}}
The compound adds to cyclohexene to give trans-{{chem2|C6H10}}-1,2-{{chem2|(PCl2)2}}.