dipraglurant

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = 6-Fluoro-2-[4-(2-pyridinyl)-3-butyn-1-yl]imidazo[1,2-a]pyridine

| image = Dipraglurant.svg

| CAS_number = 872363-17-2

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = CV8JZR21A1

| ATC_prefix = None

| ATC_suffix=

| PubChem= 44557636

| DrugBank=

| ChemSpiderID= 25069676

| synonyms = ADX-48621

| C=16 | H=12 | F=1 | N=3

| smiles= c1ccnc(c1)C#CCCc2cn3cc(ccc3n2)F

| StdInChI= 1S/C16H12FN3/c17-13-8-9-16-19-15(12-20(16)11-13)7-2-1-5-14-6-3-4-10-18-14/h3-4,6,8-12H,2,7H2

| StdInChIKey= LZXMUJCJAWVHPZ-UHFFFAOYSA-N

| bioavailability=

| protein_bound=

| metabolism=

| elimination_half-life =

| excretion=

| pregnancy_AU=

| pregnancy_US=

| pregnancy_category=

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status=

| routes_of_administration =

}}

Dipraglurant (INN; development code ADX-48621) is a negative allosteric modulator of the mGlu₅ receptor which is under development by Addex Therapeutics for the treatment of Parkinson's disease levodopa-induced dyskinesia (PD-LID).{{cite book | vauthors = Martinez A, Gil C |title=Emerging Drugs and Targets for Parkinson's Disease|url=https://books.google.com/books?id=g3_8KlQvenAC&pg=PA255|date=29 July 2013|publisher=Royal Society of Chemistry|isbn=978-1-84973-617-6|pages=255–}}{{cite book| vauthors = Macor JE |title=Annual Reports in Medicinal Chemistry|url=https://books.google.com/books?id=xpe9Mk50BGsC&pg=PA83|year=2012|publisher=Academic Press|isbn=978-0-12-396492-2|pages=83–}}{{cite book| vauthors = Fox SH, Brotchie JM |title=Levodopa-Induced Dyskinesia in Parkinson's Disease|url=https://books.google.com/books?id=ME69BAAAQBAJ&pg=PA323|date=8 October 2014|publisher=Springer|isbn=978-1-4471-6503-3|pages=323–}} As of 2014, it is in phase II clinical trials for this indication. Addex Therapeutics is also investigating an extended-release formulation of dipraglurant for the treatment of non-parkinsonian dystonia.{{cite web | url = http://www.addextherapeutics.com/rd/pipeline/dipra-er/ | title = Dipraglurant-ER for dystonia | publisher = Addex Therapeutics | access-date = 2014-12-28 | archive-date = 2014-12-28 | archive-url = https://web.archive.org/web/20141228103548/http://www.addextherapeutics.com/rd/pipeline/dipra-er/ | url-status = dead }}