diptoindonesin A

{{chembox

| Verifiedfields =

| verifiedrevid =

| Name = Diptoindonesin A

| Reference =

| ImageFile = Diptoindonesin A.svg

| ImageSize = 250px

| IUPACName =

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo_Ref =

| CASNo = 497088-92-3

| ChEMBL_Ref =

| ChEMBL =

| PubChem = 70853657

| SMILES = C(=C/C1=CC=C(O)C=C1)\C2=C3C(=C(C(O)=C2)[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)O[C@H]([C@@H]3C5=CC(O)=CC(O)=C5)C6=CC=C(O)C=C6

| ChemSpiderID_Ref =

| ChemSpiderID =

| StdInChI_Ref =

| StdInChI = 1S/C34H32O11/c35-15-25-29(41)30(42)31(43)34(44-25)28-24(40)13-18(4-1-16-2-7-20(36)8-3-16)26-27(19-11-22(38)14-23(39)12-19)32(45-33(26)28)17-5-9-21(37)10-6-17/h1-14,25,27,29-32,34-43H,15H2/b4-1+/t25-,27-,29-,30+,31-,32+,34+/m1/s1

| StdInChIKey_Ref =

| StdInChIKey = YOPYGGKAYWMQAB-APZUKWRQSA-N

}}

|Section2={{Chembox Properties

| Formula = C₃₄H₃₂O₁₁

| MolarMass = 616.61 g/mol

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Diptoindonesin A is a C-glucoside of ε-viniferin isolated from the two Dipterocarpaceae Shorea seminis{{Cite journal | last1 = Aminah | first1 = N. S. | last2 = Achmad | first2 = S. A. | last3 = Aimi | first3 = N. | last4 = Ghisalberti | first4 = E. L. | last5 = Hakim | first5 = E. H. | last6 = Kitajima | first6 = M. | last7 = Syah | first7 = Y. M. | last8 = Takayama | first8 = H. | doi = 10.1016/S0367-326X(02)00179-X | title = Diptoindonesin A, a new C-glucoside of ε-viniferin from Shorea seminis (Dipterocarpaceae) | journal = Fitoterapia | volume = 73 | issue = 6 | pages = 501–507 | year = 2002 | pmid = 12385874}} and Dryobalanops aromatica.{{Cite journal | last1 = Wibowo | first1 = A. | last2 = Ahmat | first2 = N. | last3 = Hamzah | first3 = A. S. | last4 = Sufian | first4 = A. S. | last5 = Ismail | first5 = N. H. | last6 = Ahmad | first6 = R. | last7 = Jaafar | first7 = F. M. | last8 = Takayama | first8 = H. | doi = 10.1016/j.fitote.2011.02.006 | title = Malaysianol A, a new trimer resveratrol oligomer from the stem bark of Dryobalanops aromatica | journal = Fitoterapia | volume = 82 | issue = 4 | pages = 676–681 | year = 2011 | pmid = 21338657}}