ditophal

{{Short description|Chemical compound}}

{{cs1 config|name-list-style=vanc}}{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 451549711

| IUPAC_name = 1-S,3-S-diethyl benzene-1,3-dicarbothioate

| image = Ditophal.png

| alt = Skeletal formula of ditophal

| width = 240

| image2 = Ditophal 3D ball.png

| alt2 = Ball-and-stick model of the ditophal molecule

| width2 = 260

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 584-69-0

| PubChem = 3083635

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 2340808

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C12H14O2S2/c1-3-15-11(13)9-6-5-7-10(8-9)12(14)16-4-2/h5-8H,3-4H2,1-2H3

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = DWGXUDUOJPYAOR-UHFFFAOYSA-N

| ATCvet =

| ATC_prefix =

| ATC_suffix =

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 40SR2754GL

| synonyms = Etusil; 1,3-Dithioisophthalic acid, diethyl ester

| C=12 | H=14 | O=2 | S=2

| smiles = CCSC(=O)C1=CC(=CC=C1)C(=O)SCC

}}

Ditophal is an antileprotic drugChemistry for Pharmacy and the Life Sciences (1996, Pearson Education Limited) Thomas, Gareth; pg.367 which is no longer marketed.{{cite book | url =https://books.google.com/books?id=DeX7jgInYFMC&pg=RA1-PA753 | isbn = 978-0-412-46630-4 | year =1999 | publisher =Chapman & Hall | location =London | title =Dictionary of pharmacological agents}}

The compound is diethyl dithiolisophthalate, the ethyl ester of a thiocarboxylic acid.{{cite book | chapter-url = https://books.google.com/books?id=RaglBdiPUXMC&pg=PA234 | chapter = The Evaluation of Present Antileprosis Compounds | isbn = 978-0-12-032907-6 | page = 234 | title = Advances in pharmacology and chemotherapy | vauthors = Garattini S | year = 1969| publisher = Academic Press }}