divaplon
{{Short description|Chemical compound}}
{{Drugbox
| verifiedrevid = 451223995
| IUPAC_name = (6-ethyl-7-methoxy-5-methylimidazo[1,2-a]pyrimidin-2-yl)-phenylmethanone
| image = Divaplon Structure.svg
| width = 180
| tradename =
| pregnancy_US =
| legal_US =
| bioavailability =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 90808-12-1
| ATC_prefix = none
| ATC_suffix =
| PubChem = 65822
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 4AOV43246G
| ChemSpiderID = 59234
| ChEMBL = 281164
| C=17 | H=17 | N=3 | O=2
| smiles = CCC1=C(N2C=C(N=C2N=C1OC)C(=O)C3=CC=CC=C3)C
| StdInChI = 1S/C17H17N3O2/c1-4-13-11(2)20-10-14(18-17(20)19-16(13)22-3)15(21)12-8-6-5-7-9-12/h5-10H,4H2,1-3H3
| StdInChIKey = NRJVHCSYLGLURI-UHFFFAOYSA-N
}}
Divaplon (RU-32698) is a nonbenzodiazepine, anxiolytic and anticonvulsant drug from the imidazopyrimidine family of drugs. It acts as a partial agonist at the "benzodiazepine site" of the GABAA receptor in the brain.{{cite journal | vauthors = Feely M, Boyland P, Picardo A, Cox A, Gent JP | title = Lack of anticonvulsant tolerance with RU 32698 and Ro 17-1812 | journal = European Journal of Pharmacology | volume = 164 | issue = 2 | pages = 377–80 | date = May 1989 | pmid = 2759183 | doi = 10.1016/0014-2999(89)90482-2 }}{{cite journal | vauthors = Sanger DJ, Joly D, Perrault G | s2cid = 32627339 | title = Benzodiazepine (omega) receptor partial agonists and the acquisition of conditioned fear in mice | journal = Psychopharmacology | volume = 121 | issue = 1 | pages = 104–8 | date = September 1995 | pmid = 8539334 | doi = 10.1007/BF02245596 }}{{cite journal | vauthors = Pellón R, Ruíz A, Lamas E, Rodríguez C | title = Pharmacological analysis of the effects of benzodiazepines on punished schedule-induced polydipsia in rats | journal = Behavioural Pharmacology | volume = 18 | issue = 1 | pages = 81–7 | date = February 2007 | pmid = 17218801 | doi = 10.1097/FBP.0b013e3280143212 | s2cid = 40188048 }}
References
{{reflist}}
{{Anxiolytics}}
{{GABAAR PAMs}}