dodecamethylcyclohexasilane

{{Chembox

| ImageFile1 = Me12Si6.svg

| ImageSize1 =

| ImageAlt1 =

| ImageFile2 = Dodecamethylcyclohexasilane-from-xtal-3D-bs-17-grey.png

| IUPACName = 1,1,2,2,3,3,4,4,5,5,6,6-dodecamethylhexasilinane

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 4098-30-0

| CASNo_Ref = {{Cascite|correct|CAS}}

| ChemSpiderID = 70132

| EC_number = 223-860-0

| PubChem = 77732

| StdInChI=1S/C12H36Si6/c1-13(2)14(3,4)16(7,8)18(11,12)17(9,10)15(13,5)6/h1-12H3

| StdInChIKey = RTCLHEHPUHREBC-UHFFFAOYSA-N

| SMILES = C[Si]1([Si]([Si]([Si]([Si]([Si]1(C)C)(C)C)(C)C)(C)C)(C)C)C

}}

|Section2={{Chembox Properties

| Formula = {{chem2|Si6(CH3)12}}

| C=12|H=36|Si=6

| Appearance = colorless solid

| Density = 0.988 g/cm³

| MeltingPtC = 254-257

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Dodecamethylcyclohexasilane is the organosilicon compound with the formula {{chem2|Si6(CH3)12}}. It is one of the more readily prepared and easily handled polysilanes. Dodecamethylcyclohexasilane is produced by reduction of dimethyldichlorosilane with sodium-potassium alloy:{{cite book |doi=10.1002/9780470132500.ch62|title=Dodecamethylcyclohexasilane|series=Inorganic Syntheses|year=1979|last1=West|first1=Robert|last2=Brough|first2=Lawrence|last3=Wojnowski|first3=Wieslaw|pages=265–268|isbn=9780470132500|volume=19}}

:{{chem2|6 (CH3)2SiCl2 + 12 M → Si6(CH3)12 + 12 MCl}}

where M is Na or K. The reaction also produces a polymer poly(dimethylsilylene) {{chem2|[\sSi(CH3)2\s]_{n}|}} and a cyclic compound decamethylcyclopentasilane {{chem2|Si5(CH3)10}}.

{{Gallery

| height = 120

| align = center

| File:Poly(dimethylsilylene) molecule.png

| Poly(dimethylsilylene), a polymer

| alt1 = Poly(dimethylsilylene) molecule

| File:Decamethylcyclopentasilane molecule.png

| Decamethylcyclopentasilane, a cyclic compound

| alt2 = Decamethylcyclopentasilane molecule

}}

The chair conformer of dodecamethylcyclohexasilane was confirmed by X-ray crystallography.{{ cite journal | title = Crystal and molecular structure of dodecamethylcyclohexasilane | first1 = H. L. | last1 = Carrell | first2 = J. | last2 = Donohue | journal = Acta Crystallogr. B | volume = 28 | year = 1972 | issue = 5 | pages = 1566–1571 | doi = 10.1107/S0567740872004595 | bibcode = 1972AcCrB..28.1566C }}{{cite journal |doi=10.1002/zaac.201800171|title=Synthesis of Dodecaallylhexasilacyclohexane and Its Convertibility|year=2018|last1=Omatsu|first1=Yamato|last2=Mizuhata|first2=Yoshiyuki|last3=Tokitoh|first3=Norihiro|journal=Zeitschrift für Anorganische und Allgemeine Chemie|volume=644|issue=17|pages=930–934|s2cid=105286121|doi-access=free}}