domoprednate
{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields =
| Watchedfields =
| verifiedrevid =
| IUPAC_name = [(1R,4aS,4bS,10aR,10bS,11S,12aS)-1-Acetyl-11-hydroxy-10a,12a-dimethyl-8-oxo-2,3,4,4a,4b,5,6,10b,11,12-decahydrochrysen-1-yl] butanoate
| image = Domoprednate.svg
| width = 200px
| tradename = Stermonid
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration = Topical
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref =
| CAS_number = 66877-67-6
| CAS_supplemental =
| class = Corticosteroid; Glucocorticoid
| ATC_prefix =
| ATC_suffix =
| ATC_supplemental =
| PubChem = 68868
| IUPHAR_ligand =
| DrugBank_Ref =
| DrugBank =
| ChemSpiderID_Ref =
| ChemSpiderID = 62100
| UNII = 910G0QIM2M
| KEGG =
| ChEBI =
| ChEMBL = 2106538
| C=26 | H=36 | O=5
| SMILES = CCCC(=O)O[C@@]1(CCC[C@@H]2[C@@]1(C[C@@H]([C@H]3[C@H]2CCC4=CC(=O)C=C[C@]34C)O)C)C(=O)C
| StdInChI_Ref =
| StdInChI = 1S/C26H36O5/c1-5-7-22(30)31-26(16(2)27)12-6-8-20-19-10-9-17-14-18(28)11-13-24(17,3)23(19)21(29)15-25(20,26)4/h11,13-14,19-21,23,29H,5-10,12,15H2,1-4H3/t19-,20-,21-,23+,24-,25-,26-/m0/s1
| StdInChIKey_Ref =
| StdInChIKey = IYBYNRHXGXDDDS-VRRJBYJJSA-N
| synonyms = Ro 12-7024; 11β-Hydroxy-D-homopregna-1,4-diene-3,20-dione 17α-butyrate
}}
Domoprednate (brand name Stermonid; developmental code name Ro 12-7024) is a synthetic glucocorticoid corticosteroid which was developed in the late 1970s and 1980s.{{cite book|author=J. Elks|title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA465|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=465–}}{{cite journal | vauthors = Schmidt H, Hjorth N, Holm P | title = A randomized trial on the D-homosteroid domoprednate (Ro 12-7024) in the treatment of dermatoses | journal = Dermatologica | volume = 168 | issue = 3 | pages = 127–30 | year = 1984 | doi = 10.1159/000249683 | pmid = 6370748 }}{{cite journal | vauthors = Serup J, Holm P | title = Domoprednate (Stermonid), a topical D-homocorticosteroid, skin atrophy and telangiectasia. A double-blind, randomized comparison with hydrocortisone butyrate, betamethasone valerate, clobetasole propionate and placebo | journal = Dermatologica | volume = 170 | issue = 4 | pages = 189–94 | year = 1985 | doi = 10.1159/000249529 | pmid = 3888708 }}{{cite journal | vauthors = Christiansen JV, Foged E, Holm P, Jørgensen AS, Reymann F | title = The treatment of psoriasis with 0.1% domoprednate (a D-homocorticosteroid) and 0.1% betamethasone valerate ointment. A double-blind, randomized trial | journal = Dermatologica | volume = 170 | issue = 4 | pages = 195–8 | year = 1985 | doi = 10.1159/000249530 | pmid = 3888709 }}{{cite journal | vauthors = Schmidt H, Hjorth N, Holm P | title = Domoprednate, a new nonhalogenated topical steroid: comparison to hydrocortisone butyrate | journal = Dermatologica | volume = 175 | issue = 3 | pages = 145–7 | year = 1987 | doi = 10.1159/000248813 | pmid = 3653463 }}
References
{{Reflist|2}}
{{Glucocorticoids and antiglucocorticoids}}
{{Glucocorticoid receptor modulators}}
{{steroid-stub}}