doxercalciferol

{{Chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 455346435

| ImageFile = Doxercalciferol.svg

| ImageSize = 150px

| IUPACName = (1S,3R,5Z,7E,22E)-9,10-Secoergosta-5,7,10,22-tetraene-1,3-diol

| OtherNames = 1-Hydroxyergocalciferol; 1-Hydroxyvitamin D2; 1α-Hydroxyergocalciferol; 1α-Hydroxyvitamin D2; Hectorol; TSA 840

|Section1={{Chembox Identifiers

| IUPHAR_ligand = 2790

| CASNo = 54573-75-0

| CASNo_Ref = {{cascite|correct|??}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 3DIZ9LF5Y9

| PubChem = 5281107

| DrugBank_Ref = {{drugbankcite|changed|drugbank}}

| DrugBank = DB06410

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 4444554

| ChEBI = 4712

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1200810

| SMILES = O[C@@H]1CC(\C(=C)[C@@H](O)C1)=C\C=C2/CCC[C@]3([C@H]2CC[C@@H]3[C@@H](/C=C/[C@H](C)C(C)C)C)C

| InChI = 1/C28H44O2/c1-18(2)19(3)9-10-20(4)25-13-14-26-22(8-7-15-28(25,26)6)11-12-23-16-24(29)17-27(30)21(23)5/h9-12,18-20,24-27,29-30H,5,7-8,13-17H2,1-4,6H3/b10-9+,22-11+,23-12-/t19-,20+,24+,25+,26-,27-,28+/m0/s1

| InChIKey = HKXBNHCUPKIYDM-CGMHZMFXBN

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C28H44O2/c1-18(2)19(3)9-10-20(4)25-13-14-26-22(8-7-15-28(25,26)6)11-12-23-16-24(29)17-27(30)21(23)5/h9-12,18-20,24-27,29-30H,5,7-8,13-17H2,1-4,6H3/b10-9+,22-11+,23-12-/t19-,20+,24+,25+,26-,27-,28+/m0/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = HKXBNHCUPKIYDM-CGMHZMFXSA-N

}}

|Section2={{Chembox Properties

| C=28 | H=44 | O=2

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section6={{Chembox Pharmacology

| ATCCode_prefix = H05

| ATCCode_suffix = BX03

}}

|Section7={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Doxercalciferol (or 1-hydroxyergocalciferol, trade name Hectorol) is drug for secondary hyperparathyroidism and metabolic bone disease.{{cite journal | author = Sprague S M | author2 = Ho L T | title = Oral doxercalciferol therapy for secondary hyperparathyroidism in a peritoneal dialysis patient | journal = Clinical Nephrology | year = 2002 | volume = 58 | issue = 2 | pages = 155–160 | doi = 10.5414/cnp58155 | pmid = 12227689}} It is a synthetic analog of ergocalciferol (vitamin D₂). It suppresses parathyroid synthesis and secretion.{{cite web | url = https://www.drugs.com/ppa/doxercalciferol.html | title = Doxercalciferol | publisher = Drugs.com}}

Doxercalciferol is the vitamin D₂ analogue of alfacalcidol.{{cite journal|last1=Upton|first1=R. A.|last2=Knutson|first2=J. C.|last3=Bishop|first3=C. W.|last4=LeVan|first4=L. W.|title=Pharmacokinetics of doxercalciferol, a new vitamin D analogue that lowers parathyroid hormone|journal=Nephrology Dialysis Transplantation|date=1 April 2003|volume=18|issue=4|pages=750–758|doi=10.1093/ndt/gfg030|pmid=12637645 |doi-access=free}} It undergoes 25-hydroxylation in the liver to become the active ercalcitriol, without the involvement of kidneys.{{cite web|title=HECTOROL INJECTION (doxercalciferol)|url=https://www.accessdata.fda.gov/drugsatfda_docs/label/2005/021027s012lbl.pdf|archive-url=https://web.archive.org/web/20170227211620/http://www.accessdata.fda.gov/drugsatfda_docs/label/2005/021027s012lbl.pdf|url-status=dead|archive-date=February 27, 2017|website=FDA accessdata|accessdate=21 April 2018}}