ecadotril
{{chembox
| ImageFile = Ecadotril.svg
| ImageSize = 200px
| PIN = Benzyl [(2S)-3-(acetylsulfanyl)-2-benzylpropanamido]acetate
| OtherNames =
| Section1 = {{Chembox Identifiers
| CASNo = 112573-73-6
| PubChem = 60561
| ChemSpiderID = 54591
| SMILES = O=C(SC[C@H](C(=O)NCC(=O)OCc1ccccc1)Cc2ccccc2)C
| InChI = 1/C21H23NO4S/c1-16(23)27-15-19(12-17-8-4-2-5-9-17)21(25)22-13-20(24)26-14-18-10-6-3-7-11-18/h2-11,19H,12-15H2,1H3,(H,22,25)/t19-/m1/s1
| InChIKey = ODUOJXZPIYUATO-LJQANCHMBY
| StdInChI = 1S/C21H23NO4S/c1-16(23)27-15-19(12-17-8-4-2-5-9-17)21(25)22-13-20(24)26-14-18-10-6-3-7-11-18/h2-11,19H,12-15H2,1H3,(H,22,25)/t19-/m1/s1
| StdInChIKey = ODUOJXZPIYUATO-LJQANCHMSA-N
| ChEMBL = 1516410
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 6XSR933SRK
}}
| Section2 = {{Chembox Properties
| C=21|H=23|N=1|O=4|S=1
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility =
}}
| Section3 = {{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
}}
Ecadotril is a neutral endopeptidase inhibitor ((NEP{{cite journal |vauthors=Le Moual H, Roques BP, Crine P, Boileau G | title = Substitution of potential metal-coordinating amino acid residues in the zinc-binding site of endopeptidase-24.11. | journal = FEBS Lett. | volume = 324 | issue = 2 | pages = 196–200 |date=June 1993 | pmid = 8099556 | doi = 10.1016/0014-5793(93)81392-D | doi-access = free | bibcode = 1993FEBSL.324..196L }}) EC 3.4.24.11{{cite journal |vauthors=Malfroy B, Schofield PR, Kuang WJ, Seeburg PH, Mason AJ, Henzel WJ | title = Molecular cloning and amino acid sequence of rat enkephalinase | journal = Biochemical and Biophysical Research Communications | volume = 144 | issue = 1 | pages = 59–66 |date=April 1987 | pmid = 3555489 | doi = 10.1016/S0006-291X(87)80475-8 }}) and determined by the presence of peptidase family M13 as a neutral endopeptidase inhibited by phosphoramidon. Ecadotril is the (S)-enantiomer of racecadotril. NEP-like enzymes include the endothelin-converting enzymes.{{cite journal |vauthors=Turner AJ, Isaac RE, Coates D | title = The neprilysin (NEP) family of zinc metalloendopeptidases: Genomics and function. | journal = BioEssays | volume = 23 | issue = 3 | pages = 261–9 |date=March 2001 | pmid = 11223883 | doi = 10.1002/1521-1878(200103)23:3<261::AID-BIES1036>3.0.CO;2-K }} The peptidase M13 family believed to activate or inactivate oligopeptide (pro)-hormones such as opioid peptides, neprilysin is another member of this group, in the case of the metallopeptidases and aspartic, the nucleophiles clan or family for example MA, is an activated water molecule. The peptidase domain for members of this family also contains a bacterial member and resembles that of thermolysin the predicted active site residues for members of this family and thermolysin occur in the motif HEXXH.{{cite journal |vauthors=Rudner DZ, Fawcett P, Losick R | title = A family of membrane-embedded metalloproteases involved in regulated proteolysis of membrane-associated transcription factors. | journal = Proc Natl Acad Sci USA | volume = 96 | issue = 26 | pages = 14765–14770 |date=December 1999 | pmid = 10611287 | doi = 10.1073/pnas.96.26.14765 | pmc=24722| doi-access = free | bibcode = 1999PNAS...9614765R }} Thermolysin complexed with the inhibitor (S)-thiorphan are isomeric thiol-containing inhibitors of endopeptidase EC 24-11{{cite journal |author1=S. L. Roderick |author2=M. C. Fournie-Zaluski |author3=B. P. Roques |author4=B. W. Matthews | title = Thiorphan and retro-thiorphan display equivalent interactions when bound to crystalline thermolysin | journal = Biochemistry | volume = 28 | issue = 4 | pages = 1493–7 |date=February 1989 | pmid = 2719912 | doi = 10.1021/bi00430a011 }} (also called "enkephalinase").