echitamidine

{{Chembox

| ImageFile = Echitamidine.svg

| ImageSize =

| ImageAlt =

| IUPACName =

| OtherNames =Methyl (19S)-19-hydroxy-2,16-didehydrocuran-17-oate

|Section1={{Chembox Identifiers

| CASNo = 38681-90-2

| CASNo_Ref = {{cascite|correct|CAS}}

| ChemSpiderID = 9166637

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 8V48NUF3JX

| PubChem = 190982

| StdInChI=1S/C20H24N2O3/c1-11(23)13-10-22-8-7-20-14-5-3-4-6-15(14)21-18(20)17(19(24)25-2)12(13)9-16(20)22/h3-6,11-13,16,21,23H,7-10H2,1-2H3/t11-,12-,13-,16-,20?/m0/s1

| StdInChIKey = DWLJVOJBWLYMJO-CZGIKHJPSA-N

| SMILES = C[C@@H]([C@@H]1CN2CCC34[C@@H]2C[C@@H]1C(=C3NC5=CC=CC=C45)C(=O)OC)O}}

|Section2={{Chembox Properties

| C=20|H=24|N=2|O=3

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Echitamidine is an indole alkaloid isolated from Alstonia boonei.{{Cite journal | pmid = 587160 | year = 1977 | last1 = Bodnar | first1 = A. | title = IV therapy. Part one: Infection control | journal = The Journal of Practical Nursing | volume = 27 | issue = 8 | pages = 18–21 | last2 = d'Agostino | first2 = J. }} Its laboratory synthesis has been reported.{{cite journal | doi = 10.1021/jo00104a042 | title = Syntheses of Strychnos- and Aspidospermatan-Type Alkaloids. 6. Total Syntheses of (±)-Echitamidine, (±)-Alstogustine, (±)-19-epi-Alstogustine, and (±)-Akuammicine | journal = The Journal of Organic Chemistry | volume = 59 | issue = 25 | pages = 7803–7806 | year = 1994 | last1 = Kuehne | first1 = Martin E. | last2 = Xu | first2 = Feng | last3 = Brook | first3 = Christopher S. }}