encyprate

{{Short description|MAOI antidepressant}}

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{Infobox drug

| drug_name = Encyprate

| image = Encyprate.svg

| width = 250px

| caption =

| pronounce =

| tradename =

| Drugs.com =

| MedlinePlus =

| licence_CA =

| licence_EU =

| DailyMedID =

| licence_US =

| pregnancy_AU =

| pregnancy_category =

| dependency_liability =

| addiction_liability =

| routes_of_administration =

| class =

| ATC_prefix =

| ATC_suffix =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action =

| excretion =

| CAS_number = 2521-01-9

| CAS_supplemental =

| PubChem = 17298

| IUPHAR_ligand =

| DrugBank =

| ChemSpiderID = 16368

| UNII = 26991ZCA4G

| KEGG = D03993

| ChEBI =

| ChEMBL = 2104204

| NIAID_ChemDB =

| PDB_ligand =

| synonyms = MO-1255

| IUPAC_name = ethyl N-benzyl-N-cyclopropylcarbamate

| C=13 | H=17 | N=1 | O=2

| SMILES=CCOC(=O)N(CC1=CC=CC=C1)C2CC2

| StdInChI=1S/C13H17NO2/c1-2-16-13(15)14(12-8-9-12)10-11-6-4-3-5-7-11/h3-7,12H,2,8-10H2,1H3

| StdInChIKey=OGXBVBBMMWSZJO-UHFFFAOYSA-N

}}

Encyprate is a monoamine oxidase inhibitor (MAOI) agent that was developed for use in the treatment of depression. It is an irreversible inhibitor of the MAO enzyme because it is agent that can form covalent bonds with the active site. As such, it is sometimes referred to as a “suicide inactivator” of MAO. It was invented by Bruce Horrom of Abbott in the 1960s by structure activity studies on pargyline.{{cite journal | vauthors = Swett LR, Martin WB, Taylor JD, Everett GM, Wykes AA, Gladish YC | title = Structure-activity relations in the pargyline series | journal = Annals of the New York Academy of Sciences | volume = 107 | issue = 3 | pages = 891–898 | date = July 1963 | pmid = 13979700 | doi = 10.1111/j.1749-6632.1963.tb13332.x | bibcode = 1963NYASA.107..891S }} Although it is not known to have ever been used in the clinic, it is an example of the heritage of agents that were developed at that time.