enestebol
{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 444396795
| IUPAC_name = (8R,9S,10R,13S,14S)-4,17-dihydroxy-10,13,17-trimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one
| image = Enestebol.png
| alt = Skeletal formula of the enestebol molecule
| width = 225px
| image2 = Enestebol 3D ball.png
| alt2 = Ball-and-stick model of the enestebol molecule
| width2 = 225px
| tradename =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration = By mouth
| class = Androgen; Anabolic steroid
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 2320-86-7
| CAS_supplemental =
| ATC_prefix =
| ATC_suffix =
| ATC_supplemental =
| PubChem = 208919
| IUPHAR_ligand =
| DrugBank_Ref =
| DrugBank =
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 16736606
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = LNS3MVH7NV
| KEGG =
| ChEBI =
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 2104239
| synonyms = 4,17β-Dihydroxy-17α-methylandrosta-1,4-dien-3-one
| C=20 | H=28 | O=3
| SMILES=C[C@]12CC[C@H]3[C@H]([C@@H]1CCC2(C)O)CCC4=C(C(=O)C=C[C@]34C)O
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C20H28O3/c1-18-9-8-16(21)17(22)15(18)5-4-12-13(18)6-10-19(2)14(12)7-11-20(19,3)23/h8-9,12-14,22-23H,4-7,10-11H2,1-3H3/t12-,13+,14+,18-,19+,20+/m1/s1
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = XMPHGFYWQPUCAG-XMUHMHRVSA-N
}}
Enestebol ({{abbrlink|INN|International Nonproprietary Name}}), also known as 4-hydroxy-17α-methyl-δ1-testosterone, as well as 4,17β-dihydroxy-17α-methylandrosta-1,4-dien-3-one, is a synthetic and orally active anabolic–androgenic steroid (AAS) and a 17α-alkylated derivative of testosterone which was never marketed.{{cite book| vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA417|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=417–}} It is closely related to oxymesterone (4-hydroxy-17α-methyltestosterone), as well as to chlorodehydromethyltestosterone (4-chloro-17α-methyl-δ1-testosterone), methylclostebol (4-chloro-17α-methyltestosterone), and metandienone (17α-methyl-δ1-testosterone).
References
{{Reflist|2}}
{{Androgen receptor modulators}}
Category:Anabolic–androgenic steroids
{{steroid-stub}}
{{genito-urinary-drug-stub}}