enloplatin

{{Short description|Pharmaceutical drug}}

{{Use dmy dates|date=June 2023}}

{{Infobox drug

| drug_name = Enloplatin

| type =

| IUPAC_name = [4-(azanidylmethyl)oxan-4-yl]methylazanide;cyclobutane-1,1-dicarboxylate;platinum(4+)

| image = Enloplatin.svg

| alt =

| caption =

| imageL =

| widthL =

| imageR =

| tradename =

| synonyms = Enloplatine, enloplatino, enloplatinum

| Drugs.com =

| MedlinePlus =

| licence_EU =

| licence_US =

| DailyMedID =

| pregnancy_AU =

| pregnancy_AU_comment =

| pregnancy_US =

| pregnancy_US_comment =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| ATC_prefix =

| ATC_suffix =

| bioavailability = 100% (IV)

| protein_bound = > 85%

| metabolism =

| elimination_half-life = 56±40{{nbsp}}hours{{nbsp}}(Whole blood)
52±40{{nbsp}}hours{{nbsp}}(Blood plasma){{cite journal | vauthors = Kudelka AP, Siddik ZH, Tresukosol D, Edwards CL, Freedman RS, Madden TL, Rastogi R, Hord M, Kim EE, Tornos C, Mante R, Kavanagh JJ | display-authors = 6 | title = A phase II and pharmacokinetic study of enloplatin in patients with platinum refractory advanced ovarian carcinoma | journal = Anti-Cancer Drugs | volume = 8 | issue = 7 | pages = 649–656 | date = August 1997 | pmid = 9311439 | doi = 10.1097/00001813-199708000-00001 | publisher = Ovid Technologies (Wolters Kluwer Health) | s2cid = 46635787 }}

| excretion = Renal

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 111523-41-2

| PubChem = 56840924

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID_Ref =

| ChemSpiderID = 61983

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = C7HT2IO79H

| KEGG_Ref =

| KEGG =

| ChEBI_Ref =

| ChEBI =

| ChEMBL_Ref =

| ChEMBL =

| PDB_ligand =

| chemical_formula = C₁₃H₂₀N₂O₅Pt

| C = 13

| H = 20

| N = 2

| O = 5

| Pt = 1

| smiles = C1CC(C1)(C(=O)[O-])C(=O)[O-].C1COCCC1(C[NH-])C[NH-].[Pt+4]

| StdInChI_Ref =

| StdInChI = 1S/C7H14N2O.C6H8O4.Pt/c8-5-7(6-9)1-3-10-4-2-7;7-4(8)6(5(9)10)2-1-3-6;/h8-9H,1-6H2;1-3H2,(H,7,8)(H,9,10);/q-2;;+4/p-2

| StdInChIKey_Ref =

| StdInChIKey = NAFFDQVVNWTDJD-UHFFFAOYSA-L

| melting_point = 260

| melting_high = 263 {{cite journal | vauthors = Bitha P, Carvajal SG, Citarella RV, Child RG, Delos Santos EF, Dunne TS, Durr FE, Hlavka JJ, Lang SA, Lindsay HL | display-authors = 6 | title = Water-soluble third generation antitumor platinum complexes, [2,2-bis (aminomethyl)-1,3-propanediol-N,N']-[1,1-cyclobutanedicarboxylato (2-)-O,O']platinum(II) and [1,1-cyclobutanedicarboxylato(2-)-O,O'] [tetrahydro-4H-pyran-4,4-dimethanamine-N,N']platinum(II) | journal = Journal of Medicinal Chemistry | volume = 32 | issue = 8 | pages = 2015–2020 | date = August 1989 | pmid = 2754720 | doi = 10.1021/jm00128a052 | publisher = American Chemical Society (ACS) }}

| solubility = 450{{efn|As hydrate.}}

}}

Enloplatin is a water-soluble cancer medication. It is a platinum-based antineoplastic investigated for treatment of platinum-refractory ovarian cancer, in which it was demonstrated to have minimal activity.{{cite journal | vauthors = Amorusi P, Lessard D, Bansal SK, Selinger K, Yacobi A, Tonelli AP | title = Analysis of enloplatin by liquid chromatography and of platinum by atomic absorption spectrometry in various biological fluids | journal = Journal of Pharmaceutical and Biomedical Analysis | volume = 12 | issue = 8 | pages = 1023–1033 | date = August 1994 | pmid = 7819376 | doi = 10.1016/0731-7085(94)e0035-y | publisher = Elsevier BV }} This cancer is suspected to be at least partially cross-resistant with another third-generation platinum analog, zeniplatin, which also shows minimal antitumor activity in this type of cancer. Enloplatin was found to be cross-resistant with carboplatin.{{cite journal | vauthors = Kudelka AP, Siddik ZH, Tresukosol D, Edwards CL, Freedman RS, Madden TL, Rastogi R, Hord M, Kim EE, Tornos C, Mante R, Kavanagh JJ | display-authors = 6 | title = A phase II and pharmacokinetic study of enloplatin in patients with platinum refractory advanced ovarian carcinoma | journal = Anti-Cancer Drugs | volume = 8 | issue = 7 | pages = 649–656 | date = August 1997 | pmid = 9311439 | doi = 10.1097/00001813-199708000-00001 | publisher = Ovid Technologies (Wolters Kluwer Health) | s2cid = 46635787 }}

Like zeniplatin and carboplatin, use of enloplatin causes manageable nephrotoxicity, no significant neurotoxicity or ototoxicity, and dose-limiting myelosuppression.{{cite journal | vauthors = Kudelka AP, Siddik ZH, Tresukosol D, Edwards CL, Freedman RS, Madden TL, Rastogi R, Hord M, Kim EE, Tornos C, Mante R, Kavanagh JJ | display-authors = 6 | title = A phase II and pharmacokinetic study of enloplatin in patients with platinum refractory advanced ovarian carcinoma | journal = Anti-Cancer Drugs | volume = 8 | issue = 7 | pages = 649–656 | date = August 1997 | pmid = 9311439 | doi = 10.1097/00001813-199708000-00001 | publisher = Ovid Technologies (Wolters Kluwer Health) | s2cid = 46635787 }}

The drug was original developed by Wyeth, but no further development since 2000 has been reported.{{cite web | title = Enloplatin | url = https://adisinsight.springer.com/drugs/800002455 | work = AdisInsight | publisher = Springer Nature Switzerland AG }}