enoximone
{{Short description|Chemical compound}}
{{Drugbox
| Watchedfields = changed
| verifiedrevid = 443725104
| IUPAC_name = 4-Methyl-5-{[4-(methylsulfanyl)phenyl]carbonyl}-2,3-dihydro-1H-imidazol-2-one
| image = Enoximone.svg
| tradename = Perfan
| Drugs.com = {{drugs.com|international|enoximone}}
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_UK = POM
| legal_US =
| legal_status =
| routes_of_administration = Intravenous
| bioavailability = 50% (oral)
| protein_bound = 85%
| metabolism = Liver (oxidation)
| elimination_half-life = 4 to 10 hours
| excretion = Renal (60 to 70%)
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 77671-31-9
| ATC_prefix = C01
| ATC_suffix = CE03
| PubChem = 53708
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB04880
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 48492
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = C7Z4ITI7L7
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D04004
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 249856
| C=12 | H=12 | N=2 | O=2 | S=1
| smiles = O=C(/C1=C(/NC(=O)N1)C)c2ccc(SC)cc2
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C12H12N2O2S/c1-7-10(14-12(16)13-7)11(15)8-3-5-9(17-2)6-4-8/h3-6H,1-2H3,(H2,13,14,16)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = ZJKNESGOIKRXQY-UHFFFAOYSA-N
| melting_point = 255
| melting_high = 258
| melting_notes = (decomposes)
}}
Enoximone (INN, trade name Perfan) is an imidazole phosphodiesterase inhibitor. It is used in the treatment of congestive heart failure and is selective for phosphodiesterase 3.{{cite journal |vauthors=Boldt J, Suttner S |title=Combined use of ultra-short acting beta-blocker esmolol and intravenous phosphodiesterase 3 inhibitor enoximone |journal=Expert Opin Pharmacother |volume=8 |issue=13 |pages=2135–47 |date=September 2007 |pmid=17714066 |doi=10.1517/14656566.8.13.2135 |s2cid=46021219 }}
References
{{reflist}}
External links
- {{Commonscatinline}}
{{Phosphodiesterase inhibitors}}
{{Cardiac stimulants excluding cardiac glycosides}}
{{cardiovascular-drug-stub}}