enoximone

{{Short description|Chemical compound}}

{{Drugbox

| Watchedfields = changed

| verifiedrevid = 443725104

| IUPAC_name = 4-Methyl-5-{[4-(methylsulfanyl)phenyl]carbonyl}-2,3-dihydro-1H-imidazol-2-one

| image = Enoximone.svg

| tradename = Perfan

| Drugs.com = {{drugs.com|international|enoximone}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_UK = POM

| legal_US =

| legal_status =

| routes_of_administration = Intravenous

| bioavailability = 50% (oral)

| protein_bound = 85%

| metabolism = Liver (oxidation)

| elimination_half-life = 4 to 10 hours

| excretion = Renal (60 to 70%)

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 77671-31-9

| ATC_prefix = C01

| ATC_suffix = CE03

| PubChem = 53708

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB04880

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 48492

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = C7Z4ITI7L7

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D04004

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 249856

| C=12 | H=12 | N=2 | O=2 | S=1

| smiles = O=C(/C1=C(/NC(=O)N1)C)c2ccc(SC)cc2

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C12H12N2O2S/c1-7-10(14-12(16)13-7)11(15)8-3-5-9(17-2)6-4-8/h3-6H,1-2H3,(H2,13,14,16)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = ZJKNESGOIKRXQY-UHFFFAOYSA-N

| melting_point = 255

| melting_high = 258

| melting_notes = (decomposes)

}}

Enoximone (INN, trade name Perfan) is an imidazole phosphodiesterase inhibitor. It is used in the treatment of congestive heart failure and is selective for phosphodiesterase 3.{{cite journal |vauthors=Boldt J, Suttner S |title=Combined use of ultra-short acting beta-blocker esmolol and intravenous phosphodiesterase 3 inhibitor enoximone |journal=Expert Opin Pharmacother |volume=8 |issue=13 |pages=2135–47 |date=September 2007 |pmid=17714066 |doi=10.1517/14656566.8.13.2135 |s2cid=46021219 }}

References

{{reflist}}