enprofylline

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 405783678

| IUPAC_name = 3-Propyl-7H-purine-2,6-dione

| image = Enprofylline.svg

| alt = Skeletal formula

| width = 140

| image2 = Enprofylline molecule spacefill.png

| alt2 = Space-filling model of enprofylline

| tradename =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 41078-02-8

| ATC_prefix = None

| ATC_suffix =

| ATC_supplemental =

| PubChem = 1676

| DrugBank_Ref = {{drugbankcite|changed|drugbank}}

| DrugBank = DB00824

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 1613

| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = DT7DT5E518

| KEGG_Ref = {{keggcite|changed|kegg}}

| KEGG = D04006

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 126237

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 279898

| C=8 | H=10 | N=4 | O=2

| smiles = CCCn2c(=O)[nH]c(=O)c1nc[nH]c12

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C8H10N4O2/c1-2-3-12-6-5(9-4-10-6)7(13)11-8(12)14/h4H,2-3H2,1H3,(H,9,10)(H,11,13,14)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = SIQPXVQCUCHWDI-UHFFFAOYSA-N

}}

Enprofylline (3-propylxanthine) is a xanthine derivative used in the treatment of asthma, which acts as a bronchodilator. It acts primarily as a competitive nonselective phosphodiesterase inhibitor with relatively little activity as a nonselective adenosine receptor antagonist.{{cite journal |vauthors=Lunell E, Svedmyr N, Andersson KE, Persson CG |title=Effects of enprofylline, a xanthine lacking adenosine receptor antagonism, in patients with chronic obstructive lung disease |journal=European Journal of Clinical Pharmacology |volume=22 |issue=5 |pages=395–402 |year=1982 |pmid=6288396 |doi= 10.1007/bf00542541|s2cid=3240010 }}{{cite journal |author=Laursen LC |title=Anti asthmatic effects and pharmacokinetics of enprofylline--a new xanthine derivate |journal=Danish Medical Bulletin |volume=34 |issue=6 |pages=289–97 |date=December 1987 |pmid=3325233 }}