ensaculin
{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 400125842
| IUPAC_name = 7-methoxy-6-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propoxy]-3,4-dimethylchromen-2-one
| image = Ensaculin.svg
| width = 240
| tradename =
| routes_of_administration =
| elimination_half-life = 13.7 hours
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 155773-59-4
| ATC_prefix = none
| ATC_suffix =
| PubChem = 208923
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 1963107
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 181019
| smiles = O=C/4Oc3cc(OC)c(OCCCN2CCN(c1ccccc1OC)CC2)cc3\C(=C\4C)C
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C26H32N2O5/c1-18-19(2)26(29)33-23-17-24(31-4)25(16-20(18)23)32-15-7-10-27-11-13-28(14-12-27)21-8-5-6-9-22(21)30-3/h5-6,8-9,16-17H,7,10-15H2,1-4H3
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = FQELZLMTAPJJOL-UHFFFAOYSA-N
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| UNII_Ref = {{fdacite|changed|FDA}}
| UNII = 869PGR00AT
| C=26 | H=32 | N=2 | O=5
}}
Ensaculin (KA-672) is a drug from the coumarin family, which has been researched as a potential treatment for dementia. It acts on a number of receptor systems, being both a weak NMDA antagonist and a 5HT1A agonist.{{cite journal | vauthors = Lishko PV, Maximyuk OP, Chatterjee SS, Nöldner M, Krishtal OA | title = The putative cognitive enhancer KA-672.HCl is an uncompetitive voltage-dependent NMDA receptor antagonist | journal = NeuroReport | volume = 9 | issue = 18 | pages = 4193–7 | date = December 1998 | pmid = 9926872 | doi = 10.1097/00001756-199812210-00035 | s2cid = 29960822 }}{{cite journal | vauthors = Winter JC, Helsley SE, Rabin RA | title = The discriminative stimulus effects of KA 672, a putative cognitive enhancer: evidence for a 5-HT1A component | journal = Pharmacology, Biochemistry, and Behavior | volume = 60 | issue = 3 | pages = 703–7 | date = July 1998 | pmid = 9678654 | doi = 10.1016/S0091-3057(98)00043-4 | s2cid = 6493994 }} Animal studies have shown promising nootropic effects,{{cite journal | vauthors = Hoerr R, Noeldner M | title = Ensaculin (KA-672 HCl): a multitransmitter approach to dementia treatment | journal = CNS Drug Reviews | volume = 8 | issue = 2 | pages = 143–58 | year = 2002 | pmid = 12177685 | pmc = 6741668 | doi = 10.1111/j.1527-3458.2002.tb00220.x }}{{cite journal | vauthors = Knauber J, Müller WE | title = Anseculin improves passive avoidance learning of aged mice | journal = Pharmacological Research | volume = 47 | issue = 3 | pages = 225–33 | date = March 2003 | pmid = 12591018 | doi = 10.1016/S1043-6618(02)00311-0 }} although efficacy in humans has yet to be proven. It was well tolerated in human trials, with the main side effect being orthostatic hypotension (low blood pressure upon standing).{{cite journal | vauthors = Sourgens H, Hoerr R, Biber A, Steinbrede H, Derendorf H | title = KA 672-HCl, a neuronal activator against dementia: tolerability, safety, and preliminary pharmacokinetics after single and multiple oral doses in healthy male and female volunteers | journal = Journal of Clinical Pharmacology | volume = 38 | issue = 4 | pages = 373–81 | date = April 1998 | pmid = 9590466 | doi = 10.1002/j.1552-4604.1998.tb04438.x | s2cid = 32558296 }}
See also
References
{{Reflist|2}}
{{Piperazines}}
{{Anti-dementia drugs}}
{{coumarin}}
Category:2-Methoxyphenyl compounds
{{nervous-system-drug-stub}}