enterodiol
{{short description|Lignan formed by the action of intestinal bacteria on lignan precursors found in plants.[1]}}
{{Chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 443726976
| ImageFile = Enterodiol.png
| ImageSize = 180px
| PIN = (2R,3R)-2,3-Bis[(3-hydroxyphenyl)methyl]butane-1,4-diol
| OtherNames = (−)-Enterodiol
|Section1={{Chembox Identifiers
| CASNo_Ref = {{cascite|correct|??}}
| CASNo = 80226-00-2
| PubChem = 115089
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = BZF4X2AWRP
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = C18166
| SMILES = C1=CC(=CC(=C1)O)C[C@@H](CO)[C@@H](CC2=CC(=CC=C2)O)CO
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 102992
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 471076
| InChI = 1/C18H22O4/c19-11-15(7-13-3-1-5-17(21)9-13)16(12-20)8-14-4-2-6-18(22)10-14/h1-6,9-10,15-16,19-22H,7-8,11-12H2/t15-,16-/m0/s1
| InChIKey = DWONJCNDULPHLV-HOTGVXAUBO
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C18H22O4/c19-11-15(7-13-3-1-5-17(21)9-13)16(12-20)8-14-4-2-6-18(22)10-14/h1-6,9-10,15-16,19-22H,7-8,11-12H2/t15-,16-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = DWONJCNDULPHLV-HOTGVXAUSA-N
}}
|Section2={{Chembox Properties
| C=18|H=22|O=4
| Appearance = colorless
| Density =
| MeltingPt =
| BoilingPt =
| Solubility =
}}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
}}
Enterodiol is an organic compound with the formula [HOC6H4CH2CH(CH2OH)]2.
It is formed by the action of intestinal bacteria on lignan precursors. As such it is sometimes classified as a enterolignan or mammalian lignan.{{cite journal |doi=10.1080/10408360701612942|title=Lignans and Human Health|year=2007|last1=Adlercreutz|first1=Herman|journal=Critical Reviews in Clinical Laboratory Sciences|volume=44|issue=5–6|pages=483–525|pmid=17943494|s2cid=31753060}}{{cite journal | author = Lampe JW | title = Isoflavonoid and lignan phytoestrogens as dietary biomarkers | journal = J Nutr | year = 2003 | volume = 133 | issue = Suppl 3 | pages = 956S–964S | pmid = 12612182 | doi=10.1093/jn/133.3.956S| doi-access = free }} Elevated levels of enterodiol in urine are attributed consumption of tea and other lignan-rich foods.{{cite journal |doi=10.1093/ajcn/54.6.1093|title=Urinary excretion of lignans and isoflavonoid phytoestrogens in Japanese men and women consuming a traditional Japanese Diet|year=1991|last1=Adlercreutz|first1=H.|last2= Honjo|first2=H.|last3=Higashi|first3=A.|last4=Fotsis|first4=T.|last5= Hämäläinen|first5=E.|last6=Hasegawa|first6=T.|last7=Okada|first7=H.|journal=The American Journal of Clinical Nutrition|volume=54|issue=6|pages=1093–1100|pmid=1659780|doi-access=free}}