enviomycin

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 443977985

| IUPAC_name = 3,6-diamino-N-[(3R,6Z)-3-(2-amino-3,4,5,6-tetrahydropyrimidin-4-yl)-6-[(carbamoylamino)methylidene]-9,12-bis(hydroxymethyl)-2,5,8,11,14-pentaoxo-1,4,7,10,13-pentazacyclohexadec-15-yl]-4-hydroxyhexanamide

| image = Enviomycin.svg

| tradename =

| Drugs.com = {{drugs.com|international|enviomycin}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status = Rx-only

| routes_of_administration = IM

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 33103-22-9

| ATC_prefix = J04

| ATC_suffix = AB06

| ATC_supplemental =

| PubChem = 3032903

| DrugBank_Ref = {{drugbankcite|changed|drugbank}}

| DrugBank = DB08993

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = XU299C23A2

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D07897

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 2146142

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 16736480

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C25H43N13O10/c26-3-1-16(41)10(27)5-17(42)33-12-6-31-23(47)18(11-2-4-30-24(28)37-11)38-20(44)13(7-32-25(29)48)34-21(45)14(8-39)36-22(46)15(9-40)35-19(12)43/h7,10-12,14-16,18,39-41H,1-6,8-9,26-27H2,(H,31,47)(H,33,42)(H,34,45)(H,35,43)(H,36,46)(H,38,44)(H3,28,30,37)(H3,29,32,48)/b13-7-/t10-,11-,12+,14+,15+,16-,18+/m1/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = HPWIIERXAFODPP-GHBBWTPBSA-N

| chemical_formula =

| C=25 | H=43 | N=13 | O=10

| smiles = C1CN=C(NC1C2C(=O)NCC(C(=O)NC(C(=O)NC(C(=O)NC(=CNC(=O)N)C(=O)N2)CO)CO)NC(=O)CC(C(CCN)O)N)N

}}

Enviomycin (INN, also called tuberactinomycin N) is an antibiotic drug, isolated from Streptomyces griseoverticillatus var. tuberacticus.[https://patents.google.com/patent/US3892732 Jinnosuke Abe et al. Antibiotic Tuberactinomycin-N and process for production thereof. US patent 3892732] It is used in the treatment of tuberculosis.{{cite journal | vauthors = Selvakumar N, Kumar V, Acharyulu GS, Rehman F, Paramasivan CN, Prabhakar R | title = Susceptibility of south Indian strains of Mycobacterium tuberculosis to tuberactinomycin | journal = The Indian Journal of Medical Research | volume = 95 | pages = 101–4 | date = May 1992 | pmid = 1506058 }}