enzacamene

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 477222691

| Reference=[http://www.chemicalland21.com/specialtychem/finechem/3-(4-METHYLBENZYLIDEN)CAMPHOR.htm 3-(4-METHYLBENZYLIDEN)CAMPHOR] at chemicalland21.com

| ImageFile = 4-Methylbenzylidene camphor.svg

| ImageAlt = Skeletal formula of 4-methylbenzylidene camphor

| ImageFile1 = 4-Methylbenzylidene-camphor-3D-balls.png

| ImageSize1 = 220

| ImageAlt1 = Ball-and-stick model of the 4-methylbenzylidene camphor molecule

| IUPACName=(3E)-1,7,7-Trimethyl-3-[(4-methylphenyl)methylene]-2-norbornanone

| OtherNames= 4-Methylbenzylidene camphor
3-(4-Methylbenzylidene)bornan-2-one
3-(4-Methylbenzylidene)-dl-camphor

|Section1={{Chembox Identifiers

| Abbreviations = 4-MBC

| InChI = 1/C18H22O/c1-12-5-7-13(8-6-12)11-14-15-9-10-18(4,16(14)19)17(15,2)3/h5-8,11,15H,9-10H2,1-4H3/b14-11+

| InChIKey = HEOCBCNFKCOKBX-SDNWHVSQBW

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C18H22O/c1-12-5-7-13(8-6-12)11-14-15-9-10-18(4,16(14)19)17(15,2)3/h5-8,11,15H,9-10H2,1-4H3/b14-11+

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = HEOCBCNFKCOKBX-SDNWHVSQSA-N

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo=36861-47-9

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 8I3XWY40L9

| EINECS=253-242-6

| PubChem=6434217

| SMILES = O=C2\C(=C\c1ccc(cc1)C)C3CCC2(C)C3(C)C

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 4939160

}}

|Section2={{Chembox Properties

| Formula=C₁₈H₂₂O

| MolarMass=254.37 g/mol

| Appearance=White crystalline powder

| Density=

| MeltingPtC = 66 to 69

| MeltingPt_notes =

| BoilingPt=

| Solubility=Insoluble

}}

|Section3={{Chembox Hazards

| FlashPt=

| AutoignitionPt =

| GHSPictograms = {{GHS09}}

| GHSSignalWord = Warning

| HPhrases = {{H-phrases|410}}

| PPhrases = {{P-phrases|273|391|501}}

}}

|Section4={{Chembox Pharmacology

| Legal_status = Banned in Thailand, Palau and Hawaii

}}

}}

Enzacamene (INN; also known as 4-methylbenzylidene camphor or 4-MBC) is an organic camphor derivative that is used in the cosmetic industry for its ability to protect the skin against UV, specifically UV B radiation. As such, it is used in sunscreen lotions and other skincare products claiming a SPF value. Its tradenames include Eusolex 6300 (Merck) and Parsol 5000 (DSM).