eprobemide

{{Short description|Chemical compound}}

{{Drugbox

| drug_name =

| IUPAC_name = 4-Chloro-N-[3-(4-morpholinyl)propyl]benzamide

| image = Eprobemide.svg

| alt =

| caption =

| tradename = Befol (RU)

| Drugs.com =

| MedlinePlus =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category=

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status = Rx-only

| routes_of_administration = Oral

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 87940-60-1

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = URX5F7RDER

| ATCvet =

| ATC_prefix =

| ATC_suffix =

| PubChem = 65659

| DrugBank =

| ChEMBL = 2104298

| synonyms = Befol

| ChemSpiderID = 59094

| C=14 | H=19 | Cl=1 | N=2 | O=2

| smiles = C1COCCN1CCCNC(=O)C2=CC=C(C=C2)Cl

| StdInChI = 1S/C14H19ClN2O2/c15-13-4-2-12(3-5-13)14(18)16-6-1-7-17-8-10-19-11-9-17/h2-5H,1,6-11H2,(H,16,18)

| StdInChIKey = YYFGRAGNYHYWEZ-UHFFFAOYSA-N

}}

Eprobemide (INN) is a pharmaceutical drug that was used as an antidepressant in Russia (under the brand name Бефол/Befol).{{cite book | title = Dictionary of Pharmacological Agents | volume = 3 | vauthors = Ganellin CR, Triggle DJ | page = 811 | year = 1996 | isbn = 978-0412466304}} It is a non-competitive reversible inhibitor of monoamine oxidase A{{cite journal | vauthors = Gol'dina OA, Moskvitina TA, Gankina EM, Kirkel' AZ, Kamyshanskaia NS, Lopatina KI, Sokolova TV, Zagorevskiĭ VA, Val'dman AV, Gorkin VZ | display-authors = 6 | title = [The action of befol and its derivatives on monoamine oxidase of different origins] | journal = Biulleten' Eksperimental'noi Biologii I Meditsiny | volume = 111 | issue = 3 | pages = 279–80 | date = March 1991 | pmid = 2054504 }}{{cite journal | vauthors = Donskaya NS, Antonkina OA, Glukhan EN, Smirnov SK | title = Antidepressant Befol Synthesized Via Interaction of 4-Chloro-N-(3-chloropropyl)benzamide with Morpholine|journal=Pharmaceutical Chemistry Journal | date=2004-07-01 | volume=38 | series=0091-150X | issue=7 | pages=381–384 | doi=10.1023/B:PHAC.0000048439.38383.5f | s2cid = 29121452}} that exhibits selective action on serotonin deamination.{{cite web | url = https://chem.nlm.nih.gov/chemidplus/rn/87940-60-1 | title = Eprobemide | work = ChemIDplus }} Eprobemide differs from moclobemide only in the linker that connects the morpholine fragment with the chlorobenzamide — moclobemide has two carbon atoms while eprobemide has three. Its registration was cancelled on December 30, 2003.{{cite web|title=Befol | work = 4DOKTOR.RU Drug Information Handbook|url=http://www.4doktor.ru/default.aspx?drugid=35741|access-date=4 February 2014|language=Russian}}