eprosartan

{{Short description|Angiotensin II receptor antagonist}}

{{Drugbox

| Watchedfields = changed

| verifiedrevid = 461094389

| image = Eprosartan.svg

| tradename = Teveten

| Drugs.com = {{drugs.com|monograph|teveten}}

| MedlinePlus = a601237

| DailyMedID = Eprosartan

| pregnancy_AU = D

| pregnancy_AU_comment =

| pregnancy_category=

| routes_of_administration = By mouth

| ATC_prefix = C09

| ATC_suffix = CA02

| legal_AU = S4

| legal_AU_comment =

| legal_BR =

| legal_BR_comment =

| legal_CA =

| legal_CA_comment =

| legal_DE =

| legal_DE_comment =

| legal_NZ =

| legal_NZ_comment =

| legal_UK =

| legal_UK_comment =

| legal_US = Rx-only

| legal_US_comment =

| legal_EU =

| legal_EU_comment =

| legal_UN =

| legal_UN_comment =

| legal_status =

| bioavailability = 15% (Eprosartan mesylate)

| metabolism = not metabolized

| elimination_half-life = 5 to 9 hours

| excretion = Kidney 10%, bile duct 90%

| index2_label = as mesylate

| IUPHAR_ligand = 588

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 133040-01-4

| PubChem = 5281037

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB00876

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 4444504

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 2KH13Z0S0Y

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D04040

| KEGG2_Ref = {{keggcite|correct|kegg}}

| KEGG2 = D02082

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 4814

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 813

| IUPAC_name = 4-({2-Butyl-5-[2-carboxy-2-(thiophen-2-ylmethyl)eth-1-en-1-yl]-1H-imidazol-1-yl}methyl)benzoic acid

| C=23 | H=24 | N=2 | O=4 | S=1

| SMILES = O=C(O)\C(=C\c1cnc(n1Cc2ccc(C(=O)O)cc2)CCCC)Cc3sccc3

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C23H24N2O4S/c1-2-3-6-21-24-14-19(12-18(23(28)29)13-20-5-4-11-30-20)25(21)15-16-7-9-17(10-8-16)22(26)27/h4-5,7-12,14H,2-3,6,13,15H2,1H3,(H,26,27)(H,28,29)/b18-12+

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = OROAFUQRIXKEMV-LDADJPATSA-N

}}

Eprosartan, sold under the brand name Teveten among others, is an angiotensin II receptor antagonist used for the treatment of high blood pressure.{{Cite web |title=Eprosartan mesylate- eprosartan mesylate tablet, film coated |url=https://dailymed.nlm.nih.gov/dailymed/archives/fdaDrugInfo.cfm?archiveid=475394 |access-date=7 June 2023 |website=DailyMed}}

Eprosartan is sometimes paired with hydrochlorothiazide.{{Cite web |date=3 January 2012 |title=Teveten HCT- eprosartan mesylate and hydrochlorothiazide tablet |url=https://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?setid=b1dfcac3-ef66-4d3e-9d58-37d3f516eb31 |access-date=7 June 2023 |website=DailyMed}}

As with other angiotensin II receptor antagonists, eprosartan is generally better tolerated than enalapril (an ACE inhibitor), especially among the elderly.{{Cite journal |vauthors=Ruilope L, Jäger B, Prichard B |year=2001 |title=Eprosartan versus enalapril in elderly patients with hypertension: a double-blind, randomized trial |journal=Blood Press. |volume=10 |issue=4 |pages=223–9 |doi=10.1080/08037050152669747 |pmid=11800061 |s2cid=13063704 |doi-access=free}}