epsiprantel

{{Short description|Chemical compound}}

{{Drugbox

| drug_name =

| IUPAC_name = 2-(Cyclohexylcarbonyl)-2,3,6,7,8,12b-hexahydropyrazino[2,1-a] [2]benzazepin-4(1H)-one

| image = Epsiprantel 200.svg

| width = 175

| tradename = Cestex

| Drugs.com =

| MedlinePlus =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US = Rx-only

| legal_status =

| routes_of_administration = By mouth

| ATCvet = yes

| ATC_prefix = P52

| ATC_suffix = AA04

| ATC_supplemental = {{ATCvet|P52|AA54}}

| bioavailability = Minimal{{cite web|title=Cestex (epsiprantel) Veterinary Tablets. Prescribing Information|url=https://www.zoetisus.com/_locale-assets/mcm-portal-assets/products/pdf/cestex-zoetis-pi.pdf|publisher=Zoetis Inc. Kalamazoo, MI 49007|access-date=2 October 2016}}

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 98123-83-2

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 0C1SPQ0FSR

| PubChem = 72026

| ChemSpiderID = 65020

| ChEMBL = 64979

| DrugBank =

| synonyms = BRL 38705

| C=20 | H=26 | N=2 | O=2

| smiles = O=C4N2C(c1c(cccc1)CCC2)CN(C(=O)C3CCCCC3)C4

| StdInChI = 1S/C20H26N2O2/c23-19-14-21(20(24)16-8-2-1-3-9-16)13-18-17-11-5-4-7-15(17)10-6-12-22(18)19/h4-5,7,11,16,18H,1-3,6,8-10,12-14H2

| StdInChIKey = LGUDKOQUWIHXOV-UHFFFAOYSA-N

}}

Epsiprantel (trade name Cestex) is a veterinary drug which is used as an anthelmintic against tapeworms such as Echinococcus granulosus.{{cite journal | vauthors = Arru E, Garippa G, Manger BR | title = Efficacy of epsiprantel against Echinococcus granulosus infections in dogs | journal = Research in Veterinary Science | volume = 49 | issue = 3 | pages = 378–9 | date = November 1990 | doi = 10.1016/0034-5288(90)90080-N | pmid = 2267429 }}

Indications

It is indicated for the removal of cestodes (tapeworms) in cats (Dipylidium caninum and Taenia taeniaeformis) and dogs (Dipylidium caninum and Taenia pisiformis) 7 weeks of age and older.

References