epsiprantel
{{Short description|Chemical compound}}
{{Drugbox
| drug_name =
| IUPAC_name = 2-(Cyclohexylcarbonyl)-2,3,6,7,8,12b-hexahydropyrazino[2,1-a] [2]benzazepin-4(1H)-one
| image = Epsiprantel 200.svg
| width = 175
| tradename = Cestex
| Drugs.com =
| MedlinePlus =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US = Rx-only
| legal_status =
| routes_of_administration = By mouth
| ATCvet = yes
| ATC_prefix = P52
| ATC_suffix = AA04
| ATC_supplemental = {{ATCvet|P52|AA54}}
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number = 98123-83-2
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 0C1SPQ0FSR
| PubChem = 72026
| ChemSpiderID = 65020
| ChEMBL = 64979
| DrugBank =
| synonyms = BRL 38705
| C=20 | H=26 | N=2 | O=2
| smiles = O=C4N2C(c1c(cccc1)CCC2)CN(C(=O)C3CCCCC3)C4
| StdInChI = 1S/C20H26N2O2/c23-19-14-21(20(24)16-8-2-1-3-9-16)13-18-17-11-5-4-7-15(17)10-6-12-22(18)19/h4-5,7,11,16,18H,1-3,6,8-10,12-14H2
| StdInChIKey = LGUDKOQUWIHXOV-UHFFFAOYSA-N
}}
Epsiprantel (trade name Cestex) is a veterinary drug which is used as an anthelmintic against tapeworms such as Echinococcus granulosus.{{cite journal | vauthors = Arru E, Garippa G, Manger BR | title = Efficacy of epsiprantel against Echinococcus granulosus infections in dogs | journal = Research in Veterinary Science | volume = 49 | issue = 3 | pages = 378–9 | date = November 1990 | doi = 10.1016/0034-5288(90)90080-N | pmid = 2267429 }}
Indications
It is indicated for the removal of cestodes (tapeworms) in cats (Dipylidium caninum and Taenia taeniaeformis) and dogs (Dipylidium caninum and Taenia pisiformis) 7 weeks of age and older.
References
{{reflist}}
{{anthelmintics}}
Category:Heterocyclic compounds with 3 rings
{{antiinfective-drug-stub}}