ergocornine

{{short description|Chemical compound}}

{{cs1 config|name-list-style=vanc}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 424889172

| IUPAC_name = 12′-Hydroxy-2′,5′-α-bis(1-methyl-ethyl)ergotaman-3′,6′,18-trione

| image = Ergocornine.svg

| width = 150px

| tradename =

| pregnancy_category =

| legal_AU =

| legal_UK =

| legal_US =

| routes_of_administration =

| metabolism =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 564-36-3

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 7W36B25464

| ATC_prefix =

| ATC_suffix =

| PubChem = 73453

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 66155

| smiles = O=C3N1CCC[C@H]1[C@]2(O)O[C@](C(=O)N2[C@H]3C(C)C)(NC(=O)[C@@H]7/C=C6/c4cccc5c4c(c[nH]5)C[C@H]6N(C)C7)C(C)C

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C31H39N5O5/c1-16(2)26-28(38)35-11-7-10-24(35)31(40)36(26)29(39)30(41-31,17(3)4)33-27(37)19-12-21-20-8-6-9-22-25(20)18(14-32-22)13-23(21)34(5)15-19/h6,8-9,12,14,16-17,19,23-24,26,32,40H,7,10-11,13,15H2,1-5H3,(H,33,37)/t19-,23-,24+,26+,30-,31+/m1/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = UJYGDMFEEDNVBF-OGGGUQDZSA-N

| C=31 | H=39 | N=5 | O=5

}}

Ergocornine is a crystalline ergopeptine and one of the ergot alkaloids separated from ergotoxine. It is also a dopamine receptor agonist.{{cite journal | vauthors = Fuxe K, Corrodi H, Hökfelt T, Lidbrink P, Ungerstedt U | title = Ergocornine and 2-Br-alpha-ergocryptine. Evidence for prolonged dopamine receptor stimulation | journal = Medical Biology | volume = 52 | issue = 2 | pages = 121–32 | date = April 1974 | pmid = 4837435 | doi = | url = }} It was discovered by Albert Hofmann, the Swiss chemist who created LSD.{{cite book | vauthors = Stoll A, Hoffmann A | chapter = Chapter 21: The Ergot Alkaloids | page = 759 | chapter-url = https://books.google.com/books?id=MI544i8UdzUC&pg=PA759 | veditors = Manske RH | series = The alkaloids: chemistry and physiology. | volume = 8 | title = Indole alkaloids |date=1965 |publisher=Academic Press |location=New York |isbn=978-0-08-086532-4}}