esfenvalerate
{{Chembox
| Name =Esfenvalerate
| ImageFile =Esfenvalerate.svg
| ImageAlt =
| ImageCaption =
| ImageFile1 =
| ImageSize1 =
| ImageAlt1 =
| ImageCaption1 =
| PIN = (S)-Cyano(3-phenoxyphenyl)methyl (2S)-2-(4-chlorophenyl)-3-methylbutanoate
| OtherNames =Asana
(S)-Fenvalerate
(S)-cyano-(3-phenoxy phenyl)-methyl-(S)-4-chloro-α-(1-methyl ethyl) benzene acetate
Chloro-α-(1-methylethyl)benzeneacetic acid
cyano(3-phenoxyphenyl)methyl ester (CAS)
(S-(R,R))-4-chloro-α-(1-methylethyl) benzeneacetic acid
cyano-(3-phenoxyphenyl)methylester
(S)-α-cyano-3-phenoxy benzyl (S)-2-(4-chloro-phenyl) isovalerate
Fenvalerate A-Alpha
(S-(R*,R*))-Benzeneacetic acid, 4-chloro-α-(1-methylethyl)-cyano(3-phenoxyphenyl)methylester
Cyano-3-phenoxybenzyl (S)-2-(4-chlorophenyl)isovalerate
Cyano-3-phenoxybenzyl (S)-2-(4-chlorophenyl)-3-methylbutyrate{{cite web | url=https://docs.google.com/viewer?a=v&q=cache:Dj4zTYgWkVwJ:www.cdpr.ca.gov/docs/emon/pubs/fatememo/esfen.pdf+&hl=en&gl=us&pid=bl&srcid=ADGEESioBjkb-ZFR_RL4b81PgVXQtE1uuVNiP1oizd-B5RHIElqfOsbh11O7x5n5U7QO5X_Ds0xSwaqa_hO3sr8ipOGsoy7zWrd3ZHnpjvZvb9hV4Ot9XQeZEzZZKUmLOeC13D3sii_j&sig=AHIEtbT0y5uiRpRhAiBnZ4nP9zihtQ56GA | title=Environmental Fate of Esfenvalerate | publisher=California Environmental Protection Agency | access-date=January 10, 2013 | author=Kelly, Kevin}}
|Section1={{Chembox Identifiers
| Abbreviations =
| CASNo = 66230-04-4
| CASNo_Comment =
| CASNo_Ref = {{cascite|correct|CAS}}
| PubChem = 10342051
| ChemSpiderID =8517510
| EC_number = 613-911-9
| UNNumber = 3349
| UNII = 7F07OXM0PP
| DrugBank =
| KEGG = C18147
| MeSHName =
| ChEBI = 39346
| ChEMBL = 1891190
| RTECS =
| StdInChI= 1S/C25H22ClNO3/c1-17(2)24(18-11-13-20(26)14-12-18)25(28)30-23(16-27)19-7-6-10-22(15-19)29-21-8-4-3-5-9-21/h3-15,17,23-24H,1-2H3/t23-,24+/m0/s1
| StdInChIKey = NYPJDWWKZLNGGM-BJKOFHAPSA-N
| SMILES = CC(C)[C@@H](C(=O)O[C@@H](C#N)c1cccc(Oc2ccccc2)c1)c1ccc(Cl)cc1
| Beilstein = 4275674
| Gmelin =
| 3DMet =}}
|Section2={{Chembox Properties
| C=25 | H=22 | Cl=1 | N=1 | O=3
| Appearance =
| Density =1.211 g/cm3
| MeltingPtC = 60
| MeltingPt_notes =
| BoilingPt =
| BoilingPt_notes =
| LogP = 6.22
| VaporPressure =0 mmHg at 25 °C
| HenryConstant =
| AtmosphericOHRateConstant =
| pKa =
| pKb =
| Solubility =
| SolubleOther =
| Solvent =}}
|Section3={{Chembox Structure
| CrystalStruct =
| Coordination =
| MolShape = }}
|Section4={{Chembox Thermochemistry
| DeltaHc =
| DeltaHf =
| Entropy =
| HeatCapacity = }}
|Section7={{Chembox Hazards
| GHSPictograms = {{GHS06}}{{GHS07}}{{GHS08}}{{GHS09}}
| GHSSignalWord = Danger
| HPhrases = {{H-phrases|301|313|316|317|320|330|335|370|373|410}}
| PPhrases = {{P-phrases|260|261|264|270|271|272|273|280|284|301+310|302+352|304+340|305+351+338|307+311|310|312|314|320|321|330|332+313|333+313|337+313|363|391|403+233|405|501}}
| ExternalSDS =
| MainHazards =
| NFPA-H =
| NFPA-F =
| NFPA-R =
| NFPA-S =
| FlashPtC = 256
| AutoignitionPt =
| ExploLimits =
| LD50 =
| PEL = }}
|Section8={{Chembox Related
| OtherAnions =
| OtherCations =
| OtherFunction =
| OtherFunction_label =
| OtherCompounds = }}
}}
Esfenvalerate is a synthetic pyrethroid insecticide marketed under the brand Asana.{{cite web | url=http://edis.ifas.ufl.edu/pi091 | title=Pesticide Toxicity Profile: Synthetic Pyrethroid Pesticides | publisher=University of Florida | year=2012 | access-date=January 10, 2013 | author=Fishel, Frederick M. | archive-date=May 12, 2016 | archive-url=https://web.archive.org/web/20160512091153/http://edis.ifas.ufl.edu/pi091 | url-status=dead }} It is the (S)-enantiomer of fenvalerate.{{cite web | url=http://pmep.cce.cornell.edu/profiles/extoxnet/dienochlor-glyphosate/esfenvalerate-ext.html | title=Esfenvalerate | publisher=Cooperative Extension Offices of Cornell University, Michigan State University, Oregon State University, and University of California at Davis | work=EXTONET (Extension Toxicology Network) | date=May 1994 | access-date=January 10, 2013}}
In the United States, a limit of .05 ppm of the chemical's residue is permissible in food.{{cite book | title=The Code of Federal Regulations of the United States of America | publisher=U.S. Government Printing Office | year=2006 | pages=445–446 | url=https://books.google.com/books?id=ifk6AAAAIAAJ&q=%22%28S%29-cyano+%283-phenoxyphenyl%29+methyl-%28S%29-4-chloro-alpha-%281-methylethyl%29+benzeneacetate%22&pg=PA446}}