estratetraenol

{{Short description|Chemical compound}}

{{Drugbox

| verifiedrevid = 444102483

| IUPAC_name = (8S,9S,13R,14S)-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-ol

| image = Estratetraenol chemical structure.png

| width = 225px

| image2 = Estratetraenol molecule ball.png

| width2 = 225px

| tradename =

| pregnancy_category =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 1150-90-9

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 4QD0FTG3VT

| ATC_prefix = None

| PubChem = 101988

| ChemSpiderID = 92135

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| ChEBI = 62849

| synonyms = Estra-1,3,5(10),16-tetraen-3-ol

| C=18 | H=22 | O=1

| SMILES = C[C@]12CC[C@H]3[C@H]([C@@H]1CC=C2)CCC4=C3C=CC(=C4)O

| StdInChI = 1S/C18H22O/c1-18-9-2-3-17(18)16-6-4-12-11-13(19)5-7-14(12)15(16)8-10-18/h2,5,7,9,11,15-17,19H,3-4,6,8,10H2,1H3/t15-,16-,17+,18+/m1/s1

| StdInChIKey = CRMOMCHYBNOFIV-BDXSIMOUSA-N

}}

Estratetraenol, also known as estra-1,3,5(10),16-tetraen-3-ol, is an endogenous steroid found in women{{cite journal | vauthors = Thysen B, Elliott WH, Katzman PA | title = Identification of estra-1,3,5(10),16-tetraen-3-ol (estratetraenol) from the urine of pregnant women (1) | journal = Steroids | volume = 11 | issue = 1 | pages = 73–87 | date = January 1968 | pmid = 4295975 | doi = 10.1016/S0039-128X(68)80052-2 }} that has been described as having pheromone-like activities in primates,{{cite journal | vauthors = Laska M, Wieser A, Salazar LT | title = Sex-specific differences in olfactory sensitivity for putative human pheromones in nonhuman primates | journal = Journal of Comparative Psychology | volume = 120 | issue = 2 | pages = 106–112 | date = May 2006 | pmid = 16719588 | doi = 10.1037/0735-7036.120.2.106 }} including humans.{{cite journal | vauthors = Jacob S, Hayreh DJ, McClintock MK | title = Context-dependent effects of steroid chemosignals on human physiology and mood | journal = Physiology & Behavior | volume = 74 | issue = 1–2 | pages = 15–27 | year = 2001 | pmid = 11564447 | doi = 10.1016/S0031-9384(01)00537-6 | s2cid = 19312085 }}{{cite journal | vauthors = Savic I, Berglund H, Gulyas B, Roland P | title = Smelling of odorous sex hormone-like compounds causes sex-differentiated hypothalamic activations in humans | journal = Neuron | volume = 31 | issue = 4 | pages = 661–668 | date = August 2001 | pmid = 11545724 | doi = 10.1016/S0896-6273(01)00390-7 | s2cid = 2547202 | doi-access = free }}{{cite journal | vauthors = Berglund H, Lindström P, Savic I | title = Brain response to putative pheromones in lesbian women | journal = Proceedings of the National Academy of Sciences of the United States of America | volume = 103 | issue = 21 | pages = 8269–8274 | date = May 2006 | pmid = 16705035 | pmc = 1570103 | doi = 10.1073/pnas.0600331103 | doi-access = free | bibcode = 2006PNAS..103.8269B }}{{cite journal | vauthors = Berglund H, Lindström P, Dhejne-Helmy C, Savic I | title = Male-to-female transsexuals show sex-atypical hypothalamus activation when smelling odorous steroids | journal = Cerebral Cortex | volume = 18 | issue = 8 | pages = 1900–1908 | date = August 2008 | pmid = 18056697 | doi = 10.1093/cercor/bhm216 | doi-access = free }} Estratetraenol is synthesized from androstadienone by aromatase likely in the ovaries,{{cite thesis | vauthors = Weusten JJ | degree = Ph.D. |title=Biochemical pathways in human testicular steroidogenesis |year=1989 |publisher=Pressa Trajectina|url=http://repository.ubn.ru.nl/bitstream/handle/2066/113615/mmubn000001_074818627.pdf?sequence=-1}} and is related to the estrogen sex hormones, yet has no known estrogenic effects. It was first identified from the urine of pregnant women.{{cite journal | vauthors = Thysen B, Elliott WH, Katzman PA | title = Identification of estra-1,3,5(10),16-tetraen-3-ol (estratetraenol) from the urine of pregnant women (1) | journal = Steroids | volume = 11 | issue = 1 | pages = 73–87 | date = January 1968 | pmid = 4295975 | doi = 10.1016/s0039-128x(68)80052-2 }}

Estratetraenyl acetate, or estra-1,3,5(10),16-tetraen-3-yl acetate, is a more potent synthetic derivative of estratetraenol.{{cite thesis | vauthors = Lundström JN | degree = Ph.D. | title=Human pheromones : psychological and neurological modulation of a putative human pheromone | publisher=Acta Universitatis Upsaliensis | location=Uppsala | year=2005 | isbn=91-554-6297-9 | page=17}}

Estratetraenol is an estrane (C18) steroid and an analogue of estradiol where the C17β hydroxyl group has been removed and a double bond has been formed between the C16 and C17 positions.

Experiments

Experiments performed have indicated a correlation between estratetraenol and the ability to attract cooperative mates. The hormone sends olfactory signals of high fertility in pregnant and ovulating women that presents and highlights attractive qualities in those women to potential mates. These interactions between the hormone signals and males showed an increased cooperation and compassion from males to the pregnant female.{{cite journal | vauthors = Oren C, Shamay-Tsoory SG | title = Women's fertility cues affect cooperative behavior: Evidence for the role of the human putative chemosignal estratetraenol | journal = Psychoneuroendocrinology | volume = 101 | pages = 50–59 | date = March 2019 | pmid = 30408723 | doi = 10.1016/j.psyneuen.2018.10.028 | s2cid = 53217847 }}

Another study shows that the hormone can have an effect on how a male will approach the pursuance of a female by altering the level of sexual cognition and behavior. While the hormone increases the attractions of males to females, studies also show that it does not have an effect on the impulsive sexual nature of men when it relates to sexual desire and delayed gratification.{{cite journal | vauthors = Wu Y, Wei R, Ou J, Shen B, Ye Y | title = Estratetraenol increases preference for large sexual reward but not impulsivity among heterosexual males | journal = Hormones and Behavior | volume = 146 | pages = 105266 | date = November 2022 | pmid = 36152381 | doi = 10.1016/j.yhbeh.2022.105266 | s2cid = 252432682 | hdl = 10397/95794 | hdl-access = free }}

See also

References