estriol sulfate

{{Chembox

| ImageFile = Estriol 3-sulfate.svg

| ImageSize = 250px

| ImageAlt =

| IUPACName = 16α,17β-Dihydroxyestra-1,3,5(10)-trien-3-yl hydrogen sulfate

| SystematicName = (1R,2R,3aS,3bR,9bS,11aS)-1,2-Dihydroxy-11a-methyl-2,3,3a,3b,4,5,9b,10,11,11a-decahydro-1H-cyclopenta[a]phenanthren-7-yl hydrogen sulfate

| OtherNames = Estriol 3-sulfate; Estra-1,3,5(10)-triene-3,16α,17β-triol 3-sulfate

| Section1 = {{Chembox Identifiers

| CASNo = 481-95-8

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = LZ7JHK6R2A

| ChEMBL = 2074797

| ChemSpiderID = 59789

| PubChem = 66415

| SMILES = C[C@]12CC[C@H]3[C@H]([C@@H]1C[C@H]([C@@H]2O)O)CCC4=C3C=CC(=C4)OS(=O)(=O)O

| StdInChI = 1S/C18H24O6S/c1-18-7-6-13-12-5-3-11(24-25(21,22)23)8-10(12)2-4-14(13)15(18)9-16(19)17(18)20/h3,5,8,13-17,19-20H,2,4,6-7,9H2,1H3,(H,21,22,23)/t13-,14-,15+,16-,17+,18+/m1/s1

| StdInChIKey = ZORQMBLUMWNJEQ-ZXXIGWHRSA-N

}}

| Section2 = {{Chembox Properties

| C=18 | H=24 | O=6 | S=1

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Estriol sulfate, or estriol 3-sulfate, is a conjugated metabolite of estriol that is present in high quantities during pregnancy. It is formed from estriol in the liver and is eventually excreted in the urine by the kidneys. It has much higher water solubility than does estriol. Estriol sulfate is the second most prevalent conjugated metabolite of estriol during pregnancy; 35 to 46% is estriol glucuronide and 15 to 22% is estriol 3-sulfate, while the double conjugate estriol sulfate glucuronide also occurs.{{cite book|author=N. S. Assali|title=The Maternal Organism|url=https://books.google.com/books?id=mSzLBAAAQBAJ&pg=PA339|date=3 September 2013|publisher=Elsevier|isbn=978-1-4832-6380-9|pages=339–}}{{cite book|author1=Helmut Sies|author2=Lester Packer|title=Phase II Conjugation Enzymes and Transport Systems|url=https://books.google.com/books?id=tlm-C-H3DtIC&pg=PA294|year=2005|publisher=Gulf Professional Publishing|isbn=978-0-12-182805-9|pages=294–}} Estriol sulfate was a component, along with estriol glucuronide, of the early pharmaceutical estrogens Progynon and Emmenin.{{cite book|author=Thom Rooke|title=The Quest for Cortisone|url=https://books.google.com/books?id=70vvFrtpePoC&pg=PT54|date=1 January 2012|publisher=MSU Press|isbn=978-1-60917-326-5|pages=54–}}{{cite book|author=Gregory Pincus|title=Recent Progress in Hormone Research: The Proceedings of the Laurentian Hormone Conference|url=https://books.google.com/books?id=jgTgBAAAQBAJ&pg=PA307|date=22 October 2013|publisher=Elsevier Science|isbn=978-1-4832-1945-5|pages=307–}}{{cite book|author1=Robert K. Creasy|author2=Robert Resnik|author3=Charles J. Lockwood |author4=Jay D. Iams |author5=Michael F. Greene |author6=Thomas Moore |title=Creasy and Resnik's Maternal-Fetal Medicine: Principles and Practice|url=https://books.google.com/books?id=AbMKAQAAQBAJ&pg=PA104|year=2013|publisher=Elsevier Health Sciences|isbn=978-1-4557-1137-6|pages=104–}}

See also

References

{{Reflist|2}}

{{Steroid hormones}}

{{Estrogen receptor modulators}}

Category:Estriol esters

Category:Estrogens

Category:Human metabolites

Category:Sulfate esters

{{Steroid-stub}}