esuprone

{{Chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 461095771

| ImageFile = Esuprone.svg

| PIN = 3,4-Dimethyl-2-oxo-2H-1-benzopyran-7-yl ethanesulfonate

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|changed|??}}

| CASNo = 91406-11-0

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = K7EB9E48ZE

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 18504

| PubChem = 65827

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 59239

| SMILES = O=S(=O)(Oc2ccc\1c(OC(=O)/C(=C/1C)C)c2)CC

| InChI = 1/C13H14O5S/c1-4-19(15,16)18-10-5-6-11-8(2)9(3)13(14)17-12(11)7-10/h5-7H,4H2,1-3H3

| InChIKey = CHDGAVDQRSPBTA-UHFFFAOYAR

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C13H14O5S/c1-4-19(15,16)18-10-5-6-11-8(2)9(3)13(14)17-12(11)7-10/h5-7H,4H2,1-3H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = CHDGAVDQRSPBTA-UHFFFAOYSA-N

}}

|Section2={{Chembox Properties

| Properties_ref = {{cite book|last=Ganellin|first=C. R|title=Dictionary of pharmacological agents|year=1996|publisher=CRC Press|isbn=978-0-412-46630-4|pages=1056}}

| C=13 | H=14 | O=5 | S=1

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Esuprone is an experimental drug candidate being investigated as an antidepressant.{{cite book|last=Vértes|first=Attila|title=Handbook of nuclear chemistry|year=2003|publisher=Springer|isbn=978-1-4020-1316-4|pages=155}} It acts as a monoamine oxidase A (MAO-A) inhibitor.{{cite journal | pmid = 9174681 | year = 1997 | last1 = Bergström | first1 = M | last2 = Westerberg | first2 = G | last3 = Németh | first3 = G | last4 = Traut | first4 = M | last5 = Gross | first5 = G | last6 = Greger | first6 = G | last7 = Müller-Peltzer | first7 = H | last8 = Safer | first8 = A | last9 = Eckernäs | first9 = SA | last10 = Grahnér | first10 = A | last11 = Långström | first11 = B | title = MAO-A inhibition in brain after dosing with esuprone, moclobemide and placebo in healthy volunteers: In vivo studies with positron emission tomography | volume = 52 | issue = 2 | pages = 121–8 | journal = European Journal of Clinical Pharmacology | display-authors = 8 | doi=10.1007/s002280050260| s2cid = 25359613 }}